Item 3 of 43 (back to results) previous next cefamandole A cephalosporin compound having (R)-mandelamido and N-methylthiotetrazole side groups.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > cephem [CHEBI:38311] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   antibacterial drug [CHEBI:36047] (177)   cefamandole [CHEBI:3480] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   cyclic amide [CHEBI:3990] (252)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  semisynthetic derivative [CHEBI:72588] (7)   cefamandole [CHEBI:3480] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heterocyclic antibiotic [CHEBI:24531] (153)   organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   beta-lactam [CHEBI:35627] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organonitrogen heterocyclic antibiotic [CHEBI:25558] (144)   beta-lactam antibiotic [CHEBI:27933] (140)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   cephem [CHEBI:38311] (43)   cephalosporin [CHEBI:23066] (42)   cefamandole [CHEBI:3480] (1) ChEBI Compound Accession Identifier:   [CHEBI:3480] ChEBI Compound Description:   A cephalosporin compound having (R)-mandelamido and N-methylthiotetrazole side groups. ChEBI Compound Identification Number:   3480 ChEBI InChI Value:   InChI=1S/C18H18N6O5S2/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29)/t11-,13-,16-/m1/s1 ChEBI InChIKey Value:   OLVCFLKTBJRLHI-AXAPSJFSSA-N ChEBI Compound Name:   cefamandole ChEBI SMILES Value:   [H][C@]12SCC(CSc3nnnn3C)=C(N1C(=O)[C@H]2NC(=O)[C@H](O)c1ccccc1)C(O)=O ChEBI Substance ID:   87322628 ChEBI URL:   ChEBI:3480 ChemSpider ID:   401748 Ontomatica Chemical Accession Key (OnChAKey):   OLVCFLKTBJRLHI_AXAPSJFSSA_N_000_000000 PubChem Compound ID:   456255