New Search

Item 3 of 4 (back to results)
Previous previous next Next

(E)-buprofezin
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 ureas [CHEBI:47857] (101) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organosulfur compound [CHEBI:33261] (1005) 
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
 organosulfur heterocyclic compound [CHEBI:38106] (367) 
 thiadiazinane [CHEBI:38781] (4) 
 buprofezin [CHEBI:3218] (3) 
 (E)-buprofezin [CHEBI:39380] (1)
ChEBI Compound Accession Identifier  [CHEBI:39380]
ChEBI Compound Description  null
ChEBI Compound Identification Number  39380
ChEBI InChI Value  InChI=1S/C16H23N3OS/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3/b17-14+
ChEBI InChIKey Value  PRLVTUNWOQKEAI-SAPNQHFASA-N
ChEBI Compound Name  (E)-buprofezin
ChEBI SMILES Value  CC(C)N1C(=O)N(CS\C1=N\C(C)(C)C)c1ccccc1
ChEBI Substance ID  26675725
ChEBI URL  ChEBI:39380
ChemSpider ID  10441861
Ontomatica Chemical Accession Key (OnChAKey)  PRLVTUNWOQKEAI_SAPNQHFASA_N_000_000000
PubChem Compound ID  50367