Item 3 of 4 (back to results) previous next acibenzolar-S-methyl A benzothiadiazole that is the S-methyl thioester derivative of acibenzolar. It is used as a fungicide and plant activator on a variety of crops, including cotton, chili peppers, lettuce, onions, spinach, tobacco, and tomatoes.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > benzothiadiazole [CHEBI:48864] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   fungicide [CHEBI:24127] (52)   acibenzolar-S-methyl [CHEBI:73178] (1) 05. Industrial Uses  05. Industrial Uses  agrochemical [CHEBI:33286] (142)   plant activator [CHEBI:73182] (3)   acibenzolar-S-methyl [CHEBI:73178] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1)  ester [CHEBI:35701] (3370)   thiocarboxylic ester [CHEBI:26959] (311)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzothiadiazole [CHEBI:48864] (4)   acibenzolar-S-methyl [CHEBI:73178] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   thioester [CHEBI:51277] (307)   acibenzolar-S-methyl [CHEBI:73178] (1) ChEBI Compound Accession Identifier:   [CHEBI:73178] ChEBI Compound Description:   A benzothiadiazole that is the S-methyl thioester derivative of acibenzolar. It is used as a fungicide and plant activator on a variety of crops, including cotton, chili peppers, lettuce, onions, spinach, tobacco, and tomatoes. ChEBI Compound Identification Number:   73178 ChEBI InChI Value:   InChI=1S/C8H6N2OS2/c1-12-8(11)5-3-2-4-6-7(5)13-10-9-6/h2-4H,1H3 ChEBI InChIKey Value:   UELITFHSCLAHKR-UHFFFAOYSA-N ChEBI Compound Name:   acibenzolar-S-methyl ChEBI SMILES Value:   CSC(=O)c1cccc2nnsc12 ChEBI Substance ID:   162169338 ChEBI URL:   ChEBI:73178 ChemSpider ID:   77928 Ontomatica Chemical Accession Key (OnChAKey):   UELITFHSCLAHKR_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   86412