Item 3 of 74 (back to results) previous next 7,8-dihydropteroic acid A pteroic acid derivative arising from formal hydrogenation of the 7,8-double bond of pteroic acid.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > carbon group molecular entity [CHEBI:33582] > organic molecular entity [CHEBI:50860] > organic molecule [CHEBI:72695] > organic cyclic compound [CHEBI:33832] > organic heterocyclic compound [CHEBI:24532] > organonitrogen heterocyclic compound [CHEBI:38101] > pteridines [CHEBI:26373] > pterins [CHEBI:26375] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   pteroic acids [CHEBI:38795] (4)   7,8-dihydropteroic acid [CHEBI:4581] (1) ChEBI Compound Accession Identifier:   [CHEBI:4581] ChEBI Compound Description:   A pteroic acid derivative arising from formal hydrogenation of the 7,8-double bond of pteroic acid. ChEBI Compound Identification Number:   4581 ChEBI InChI Value:   InChI=1S/C14H14N6O3/c15-14-19-11-10(12(21)20-14)18-9(6-17-11)5-16-8-3-1-7(2-4-8)13(22)23/h1-4,16H,5-6H2,(H,22,23)(H4,15,17,19,20,21) ChEBI InChIKey Value:   WBFYVDCHGVNRBH-UHFFFAOYSA-N ChEBI Compound Name:   7,8-dihydropteroic acid ChEBI SMILES Value:   Nc1nc2NCC(CNc3ccc(cc3)C(O)=O)=Nc2c(=O)[nH]1 ChEBI Substance ID:   17425134 ChEBI URL:   ChEBI:4581 ChemSpider ID:   165 Ontomatica Chemical Accession Key (OnChAKey):   WBFYVDCHGVNRBH_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   170