New Search

Item 3 of 2004 (back to results)
Previous previous next Next

(-)-anaferine
null


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 (-)-anaferine [CHEBI:75] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 (-)-anaferine [CHEBI:75] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 (-)-anaferine [CHEBI:75] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 (-)-anaferine [CHEBI:75] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 piperidines [CHEBI:26151] (143) 
 piperidine alkaloid [CHEBI:26147] (10) 
 (-)-anaferine [CHEBI:75] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 (-)-anaferine [CHEBI:75] (1)
ChEBI Compound Accession Identifier  [CHEBI:75]
ChEBI Compound Description  null
ChEBI Compound Identification Number  75
ChEBI InChI Value  InChI=1S/C13H24N2O/c16-13(9-11-5-1-3-7-14-11)10-12-6-2-4-8-15-12/h11-12,14-15H,1-10H2/t11-,12-/m1/s1
ChEBI InChIKey Value  JFMCQBGTUJUOAB-VXGBXAGGSA-N
ChEBI Compound Name  (-)-anaferine
ChEBI SMILES Value  [H][C@@]1(CCCCN1)CC(=O)C[C@@]1([H])CCCCN1
ChEBI Substance ID  26697396
ChEBI URL  ChEBI:75
ChemSpider ID  391415
Ontomatica Chemical Accession Key (OnChAKey)  JFMCQBGTUJUOAB_VXGBXAGGSA_N_000_000000
PubChem Compound ID  443143