New Search

Item 3 of 5 (back to results)
Previous previous next Next

hept-6-enoic acid
A heptenoic acid with the double bond at position 6.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 unsaturated fatty acid [CHEBI:27208] (309) 
 monounsaturated fatty acid [CHEBI:25413] (113) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
 medium-chain fatty acid [CHEBI:59554] (82) 
 heptenoic acid [CHEBI:36151] (5) 
 hept-6-enoic acid [CHEBI:38363] (1)
ChEBI Compound Accession Identifier  [CHEBI:38363]
ChEBI Compound Description  A heptenoic acid with the double bond at position 6.
ChEBI Compound Identification Number  38363
ChEBI InChI Value  InChI=1S/C7H12O2/c1-2-3-4-5-6-7(8)9/h2H,1,3-6H2,(H,8,9)
ChEBI InChIKey Value  RWNJOXUVHRXHSD-UHFFFAOYSA-N
ChEBI Compound Name  hept-6-enoic acid
ChEBI SMILES Value  OC(=O)CCCCC=C
ChEBI Substance ID  24712362
ChEBI URL  ChEBI:38363
ChemSpider ID  63871
Ontomatica Chemical Accession Key (OnChAKey)  RWNJOXUVHRXHSD_UHFFFAOYSA_N_000_000000
PubChem Compound ID  70705