more general categories |
information about this item |
|
04. Bioactive Capabilities of Specific Chemicals |
 |
 |
|
04. Bioactive Capabilities of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
|
|
|
|
|
|
|
thyroxine sulfate(1-) [CHEBI:58910] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:58910] |
ChEBI Compound Description: |
Conjugate base of thyroxine sulfate having anionic carboxy and sulfate groups and the amino group protonated. |
ChEBI Compound Identification Number: |
58910 |
ChEBI InChI Value: |
InChI=1S/C15H11I4NO7S/c16-8-1-6(3-12(20)15(21)22)2-9(17)13(8)26-7-4-10(18)14(11(19)5-7)27-28(23,24)25/h1-2,4-5,12H,3,20H2,(H,21,22)(H,23,24,25)/p-1 |
ChEBI InChIKey Value: |
QYXIJUZWSSQICT-UHFFFAOYSA-M |
ChEBI Compound Name: |
thyroxine sulfate(1-) |
ChEBI SMILES Value: |
[NH3+]C(Cc1cc(I)c(Oc2cc(I)c(OS([O-])(=O)=O)c(I)c2)c(I)c1)C([O-])=O |
ChEBI Substance ID: |
99319424 |
ChEBI URL: |
ChEBI:58910 |
ChemSpider ID: |
21238540 |
Ontomatica Chemical Accession Key (OnChAKey): |
QYXIJUZWSSQICT_UHFFFAOYSA_M_000_000000 |
PubChem Compound ID: |
44237187 |