Item 4 of 40 (back to results) previous next sufentanil The carboxamide resulting from the formal condensation of the aryl amino group of 4-(methoxymethyl)-N-phenyl-1-[2-(2-thienyl)ethyl]piperidin-4-amine with propanoic acid.

Current search: 08. Chemical Category: main group molecular entity [CHEBI:33579] > p-block molecular entity [CHEBI:33675] > chalcogen molecular entity [CHEBI:33304] > sulfur molecular entity [CHEBI:26835] > organosulfur compound [CHEBI:33261] > organosulfur heterocyclic compound [CHEBI:38106] > thiophenes [CHEBI:26961] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   analgesic [CHEBI:35480] (114)   opioid analgesic [CHEBI:35482] (40)   sufentanil [CHEBI:9316] (1)  neurotransmitter agent [CHEBI:35942] (471)   opioid agent [CHEBI:60598] (32)   mu-opioid agent [CHEBI:60599] (26)   mu-opioid receptor agonist [CHEBI:55322] (22)   sufentanil [CHEBI:9316] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anaesthetic [CHEBI:38867] (64)   general anaesthetic [CHEBI:38869] (26)   intravenous anaesthetic [CHEBI:38877] (16)   sufentanil [CHEBI:9316] (1)  adjuvant [CHEBI:60809] (12)   anaesthesia adjuvant [CHEBI:60807] (10)   sufentanil [CHEBI:9316] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   sufentanil [CHEBI:9316] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperidines [CHEBI:26151] (143)   sufentanil [CHEBI:9316] (1)  organosulfur heterocyclic compound [CHEBI:38106] (367)   thiophenes [CHEBI:26961] (40)   sufentanil [CHEBI:9316] (1) ChEBI Compound Accession Identifier:   [CHEBI:9316] ChEBI Compound Description:   The carboxamide resulting from the formal condensation of the aryl amino group of 4-(methoxymethyl)-N-phenyl-1-[2-(2-thienyl)ethyl]piperidin-4-amine with propanoic acid. ChEBI Compound Identification Number:   9316 ChEBI InChI Value:   InChI=1S/C22H30N2O2S/c1-3-21(25)24(19-8-5-4-6-9-19)22(18-26-2)12-15-23(16-13-22)14-11-20-10-7-17-27-20/h4-10,17H,3,11-16,18H2,1-2H3 ChEBI InChIKey Value:   GGCSSNBKKAUURC-UHFFFAOYSA-N ChEBI Compound Name:   sufentanil ChEBI SMILES Value:   CCC(=O)N(c1ccccc1)C1(CCN(CCc2cccs2)CC1)COC ChEBI Substance ID:   111978170 ChEBI URL:   ChEBI:9316 ChemSpider ID:   38043 Ontomatica Chemical Accession Key (OnChAKey):   GGCSSNBKKAUURC_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   41693