more general categories |
information about this item |
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
|
|
|
cortisol phosphate [CHEBI:68634] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:68634] |
ChEBI Compound Description: |
A steroid phosphate that is the 21-O-phospho derivative of cortisol. |
ChEBI Compound Identification Number: |
68634 |
ChEBI InChI Value: |
InChI=1S/C21H31O8P/c1-19-7-5-13(22)9-12(19)3-4-14-15-6-8-21(25,17(24)11-29-30(26,27)28)20(15,2)10-16(23)18(14)19/h9,14-16,18,23,25H,3-8,10-11H2,1-2H3,(H2,26,27,28)/t14-,15-,16-,18+,19-,20-,21-/m0/s1 |
ChEBI InChIKey Value: |
BGSOJVFOEQLVMH-VWUMJDOOSA-N |
ChEBI Compound Name: |
cortisol phosphate |
ChEBI SMILES Value: |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]1(C)[C@@]2([H])CC[C@]1(O)C(=O)COP(O)(O)=O |
ChEBI Substance ID: |
160645727 |
ChEBI URL: |
ChEBI:68634 |
ChemSpider ID: |
390143 |
Ontomatica Chemical Accession Key (OnChAKey): |
BGSOJVFOEQLVMH_VWUMJDOOSA_N_000_000000 |
PubChem Compound ID: |
441407 |