more general categories |
information about this item |
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
|
|
|
dexamethasone phosphate [CHEBI:68637] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:68637] |
ChEBI Compound Description: |
A steroid phosphate that is the 21-O-phospho derivative of dexamethasone. |
ChEBI Compound Identification Number: |
68637 |
ChEBI InChI Value: |
InChI=1S/C22H30FO8P/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)21(15,23)17(25)10-20(16,3)22(12,27)18(26)11-31-32(28,29)30/h6-7,9,12,15-17,25,27H,4-5,8,10-11H2,1-3H3,(H2,28,29,30)/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
ChEBI InChIKey Value: |
VQODGRNSFPNSQE-CXSFZGCWSA-N |
ChEBI Compound Name: |
dexamethasone phosphate |
ChEBI SMILES Value: |
[H][C@@]12C[C@@H](C)[C@](O)(C(=O)COP(O)(O)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])CCC2=CC(=O)C=C[C@]12C |
ChEBI Substance ID: |
162012124 |
ChEBI URL: |
ChEBI:68637 |
ChemSpider ID: |
9030 |
Ontomatica Chemical Accession Key (OnChAKey): |
VQODGRNSFPNSQE_CXSFZGCWSA_N_000_000000 |
PubChem Compound ID: |
9400 |