Item 5 of 26 (back to results) previous next tetracarbonylnickel null

Current search: 08. Chemical Category: transition element molecular entity [CHEBI:33497] > d-block molecular entity [CHEBI:33676] > nickel group molecular entity [CHEBI:33747] > nickel molecular entity [CHEBI:33748] × Select any link to see items in a related category. more general categories    information about this item 08. Chemical Category  08. Chemical Category  transition element molecular entity [CHEBI:33497] (536)   d-block molecular entity [CHEBI:33676] (500)   nickel group molecular entity [CHEBI:33747] (41)   nickel molecular entity [CHEBI:33748] (26)   nickel coordination entity [CHEBI:35438] (26)   tetracarbonylnickel [CHEBI:30372] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   metal carbonyl [CHEBI:36604] (15)   tetracarbonylnickel [CHEBI:30372] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   metal carbonyl [CHEBI:36604] (15)   tetracarbonylnickel [CHEBI:30372] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   metal carbonyl [CHEBI:36604] (15)   tetracarbonylnickel [CHEBI:30372] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   metal carbonyl [CHEBI:36604] (15)   tetracarbonylnickel [CHEBI:30372] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   metal carbonyl [CHEBI:36604] (15)   tetracarbonylnickel [CHEBI:30372] (1) ChEBI Compound Accession Identifier:   [CHEBI:30372] ChEBI Compound Description:   null ChEBI Compound Identification Number:   30372 ChEBI InChI Value:   "InChI=1S/4CO.Ni/c4*1-2;" ChEBI InChIKey Value:   AWDHUGLHGCVIEG-UHFFFAOYSA-N ChEBI Compound Name:   tetracarbonylnickel ChEBI SMILES Value:   [O]#C[Ni](C#[O])(C#[O])C#[O] ChEBI Substance ID:   8146137 ChEBI URL:   ChEBI:30372 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   AWDHUGLHGCVIEG_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   518772