| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Asparagus (23) | 
 | 
| 
 | 
 Avocado (23) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 01 : Root & Tuber Vegetables Group (7) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 Endive (6) | 
 | 
| 
 | 
 Lettuce (6) | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Swiss chard (6) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Brussels sprouts (12) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 Collards (8) | 
 | 
| 
 | 
 Kale (7) | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pea (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean, succulent (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 Tangerine (7) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 Tangerine (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Barley, grain (18) | 
 | 
| 
 | 
 Rye, grain (5) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Oat, forage (13) | 
 | 
| 
 | 
 Rye, forage (8) | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Barley, straw (16) | 
 | 
| 
 | 
 Oat, straw (14) | 
 | 
| 
 | 
 Rye, straw (8) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bermuda grass, forage (1) | 
 | 
| 
 | 
 Soybean, forage (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Alfalfa (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pepper, black (3) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 methomyl [CHEBI:6835] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:6835] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 6835 | 
| ChEBI InChI Value:  | 
 InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8) | 
| ChEBI InChIKey Value:  | 
 UHXUZOCRWCRNSJ-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 methomyl | 
| ChEBI SMILES Value:  | 
 CNC(=O)ON=C(C)SC | 
| ChEBI Substance ID:  | 
 24775874 | 
| ChEBI URL:  | 
 ChEBI:6835 | 
| ChemSpider ID:  | 
 3966 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 UHXUZOCRWCRNSJ_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 4109 |