| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Milk (61) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, kidney (13) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (except kidney) (5) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, kidney (12) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (except kidney) (5) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, kidney (10) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (except kidney) (3) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, kidney (12) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (except kidney) (5) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, kidney (12) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (except kidney) (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Asparagus (23) | 
 | 
| 
 | 
 Avocado (23) | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Fig (12) | 
 | 
| 
 | 
 Globe Artichoke (19) | 
 | 
| 
 | 
 Mango (18) | 
 | 
| 
 | 
 Papaya (20) | 
 | 
| 
 | 
 Pawpaw (4) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Persimmon (8) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Ginger (2) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Yam, true, root (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Ginger (2) | 
 | 
| 
 | 
 Yam, true, root (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Endive (6) | 
 | 
| 
 | 
 Lettuce (6) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Rhubarb (3) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6A : Edible-podded legume vegetables subgroup (8) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6B : Succulent shelled pea & bean subgroup (6) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13 : Berries Group (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pistachio (28) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Barley, grain (18) | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Barley, straw (16) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cowpea, forage (5) | 
 | 
| 
 | 
 Soybean, forage (17) | 
 | 
| 
 | 
 Cowpea, hay (6) | 
 | 
| 
 | 
 Peanut, hay (19) | 
 | 
| 
 | 
 Soybean, hay (17) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 18 : Nongrass Animal Feeds (Forage, Fodder, Straw & Hay) Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sunflower, seed (16) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 paraquat [CHEBI:34905] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 paraquat [CHEBI:34905] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 paraquat [CHEBI:34905] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 paraquat [CHEBI:34905] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:34905] | 
| ChEBI Compound Description:  | 
 An organic cation that consists of 4,4'-bipyridine bearing two N-methyl substituents loctated at the 1- and 1'-positions. | 
| ChEBI Compound Identification Number:  | 
 34905 | 
| ChEBI InChI Value:  | 
 InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 | 
| ChEBI InChIKey Value:  | 
 INFDPOAKFNIJBF-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 paraquat | 
| ChEBI SMILES Value:  | 
 C[n+]1ccc(cc1)-c1cc[n+](C)cc1 | 
| ChEBI Substance ID:  | 
 11533728 | 
| ChEBI URL:  | 
 ChEBI:34905 | 
| ChemSpider ID:  | 
 NS | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 INFDPOAKFNIJBF_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 15939 |