more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Hog, fat (44) |
|
|
Hog, kidney (10) |
|
|
Hog, liver (13) |
|
|
Hog, meat (42) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, kidney (2) |
|
|
Poultry, liver (8) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (except liver & kidney) (2) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
|
|
|
Peanut (30) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
|
|
|
|
|
|
Swiss chard (6) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5B : Leafy Brassica greens subgroup (18) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Cocona (1) |
|
|
Goji berry (1) |
|
|
Naranjilla (1) |
|
|
Sunberry (1) |
|
|
|
|
|
Martynia (1) |
|
|
Okra (17) |
|
|
Roselle (1) |
|
|
|
|
|
Martynia (1) |
|
|
Okra (17) |
|
|
Roselle (1) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
|
|
|
Prune plum (18) |
|
|
Prune plum (18) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07B : Bushberry subgroup (13) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
novaluron [CHEBI:39385] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:39385] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
39385 |
ChEBI InChI Value: |
InChI=1S/C17H9ClF8N2O4/c18-8-6-7(4-5-11(8)31-16(22,23)14(21)32-17(24,25)26)27-15(30)28-13(29)12-9(19)2-1-3-10(12)20/h1-6,14H,(H2,27,28,29,30) |
ChEBI InChIKey Value: |
NJPPVKZQTLUDBO-UHFFFAOYSA-N |
ChEBI Compound Name: |
novaluron |
ChEBI SMILES Value: |
FC(OC(F)(F)F)C(F)(F)Oc1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl |
ChEBI Substance ID: |
26697523 |
ChEBI URL: |
ChEBI:39385 |
ChemSpider ID: |
84442 |
Ontomatica Chemical Accession Key (OnChAKey): |
NJPPVKZQTLUDBO_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
93541 |