| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Garlic, bulb (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Garlic, bulb (3) | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Watermelon (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Pumpkin (8) | 
 | 
| 
 | 
 Squash, winter (7) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peanut, hay (19) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pepper, black (3) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 oxamyl [CHEBI:38539] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:38539] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 38539 | 
| ChEBI InChI Value:  | 
 InChI=1S/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12) | 
| ChEBI InChIKey Value:  | 
 KZAUOCCYDRDERY-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 oxamyl | 
| ChEBI SMILES Value:  | 
 CNC(=O)ON=C(SC)C(=O)N(C)C | 
| ChEBI Substance ID:  | 
 24775769 | 
| ChEBI URL:  | 
 ChEBI:38539 | 
| ChemSpider ID:  | 
 29356 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 KZAUOCCYDRDERY_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 31657 |