more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, kidney (10) |
|
|
Hog, liver (13) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Avocado (23) |
|
|
Banana (25) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Persimmon (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5B : Leafy Brassica greens subgroup (18) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
|
|
|
Bean, succulent (18) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
|
|
|
Pear (21) |
|
|
Pear (21) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11-10 : Pome Fruit Group (5) |
|
|
Pear (21) |
|
|
Pear (21) |
|
|
Pear, Asian (1) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
Peach (26) |
|
|
Apricot (11) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
|
|
|
Apricot (11) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
|
|
|
|
buprofezin [CHEBI:3218] (3) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:3218] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
3218 |
ChEBI InChI Value: |
InChI=1S/C16H23N3OS/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 |
ChEBI InChIKey Value: |
PRLVTUNWOQKEAI-UHFFFAOYSA-N |
ChEBI Compound Name: |
buprofezin |
ChEBI SMILES Value: |
CC(C)N1C(=O)N(CSC1=NC(C)(C)C)c1ccccc1 |
ChEBI Substance ID: |
26676098 |
ChEBI URL: |
ChEBI:3218 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
PRLVTUNWOQKEAI_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
50367 |