| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Poultry, meat (32) | 
 | 
| 
 | 
 Poultry, meat byproducts (32) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Asparagus (23) | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Fig (12) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pepper (15) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Pumpkin (8) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Alfalfa (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sunflower, seed (16) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
| 
 | 
 chlorpyrifos [CHEBI:34631] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:34631] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 34631 | 
| ChEBI InChI Value:  | 
 InChI=1S/C9H11Cl3NO3PS/c1-3-14-17(18,15-4-2)16-9-7(11)5-6(10)8(12)13-9/h5H,3-4H2,1-2H3 | 
| ChEBI InChIKey Value:  | 
 SBPBAQFWLVIOKP-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 chlorpyrifos | 
| ChEBI SMILES Value:  | 
 CCOP(=S)(OCC)Oc1nc(Cl)c(Cl)cc1Cl | 
| ChEBI Substance ID:  | 
 24775716 | 
| ChEBI URL:  | 
 ChEBI:34631 | 
| ChemSpider ID:  | 
 NS | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 SBPBAQFWLVIOKP_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 2730 |