| more general categories | information about this item |  | 
| | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  |  |  |
 |
 | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  | 
|  | Milk (61) |  | 
|  | Cattle, fat (61) |  | 
|  | Cattle, liver (18) |  | 
|  | Cattle, meat (59) |  | 
|  | Cattle, meat byproducts (except liver) (9) |  | 
|  | Goat, fat (57) |  | 
|  | Goat, liver (17) |  | 
|  | Goat, meat (56) |  | 
|  | Goat, meat byproducts (except liver) (9) |  | 
|  | Hog, fat (44) |  | 
|  | Hog, liver (13) |  | 
|  | Hog, meat (42) |  | 
|  | Hog, meat byproducts (except liver) (6) |  | 
|  | Horse, fat (57) |  | 
|  | Horse, liver (17) |  | 
|  | Horse, meat (54) |  | 
|  | Horse, meat byproducts (except liver) (9) |  | 
|  | Sheep, fat (57) |  | 
|  | Sheep, liver (17) |  | 
|  | Sheep, meat (56) |  | 
|  | Sheep, meat byproducts (except liver) (9) |  | 
|  |  |  | 
|  | Persimmon (8) |  | 
|  |  |  | 
|  | Apple (37) |  | 
|  | Pear (21) |  | 
|  | Apple (37) |  | 
|  | Pear (21) |  | 
|  |  |  | 
|  | Apple (37) |  | 
|  | Pear (21) |  | 
|  | Apple (37) |  | 
|  | Pear (21) |  | 
|  |  |  | 
|  | Peach (26) |  | 
|  | Apricot (11) |  | 
|  | Nectarine (14) |  | 
|  | Peach (26) |  | 
|  |  |  | 
|  |  |  | 
|  | Peach (26) |  | 
|  | Peach (26) |  | 
|  | Nectarine (14) |  | 
|  |  |  | 
|  | Apricot (11) |  | 
|  |  |  | 
|  |  |  | 
|  | Grape (40) |  | 
|  | Grape (40) |  | 
|  |  |  | 
|  | Grape (40) |  | 
|  | Grape (40) |  | 
|  |  |  | 
|  | Almond (46) |  | 
|  | Almond (46) |  | 
|  |  |  | 
|  | Almond (46) |  | 
|  | Almond (46) |  | 
|  | 
| | 03. Biological Effects of Specific Chemicals |  |  |  |
 |
 | 03. Biological Effects of Specific Chemicals |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  | 
| | 05. Industrial Uses |  |  |  |
 |
 | 05. Industrial Uses |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  | 
| | 08. Chemical Category |  |  |  |
 |
 | 08. Chemical Category |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | clofentezine [CHEBI:39315] (1) |  | 
|  | 
| ChEBI Compound Accession Identifier: | [CHEBI:39315] | 
| ChEBI Compound Description: | null | 
| ChEBI Compound Identification Number: | 39315 | 
| ChEBI InChI Value: | InChI=1S/C14H8Cl2N4/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h1-8H | 
| ChEBI InChIKey Value: | UXADOQPNKNTIHB-UHFFFAOYSA-N | 
| ChEBI Compound Name: | clofentezine | 
| ChEBI SMILES Value: | Clc1ccccc1-c1nnc(nn1)-c1ccccc1Cl | 
| ChEBI Substance ID: | 26675940 | 
| ChEBI URL: | ChEBI:39315 | 
| ChemSpider ID: | 66321 | 
| Ontomatica Chemical Accession Key (OnChAKey): | UXADOQPNKNTIHB_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID: | 73670 |