| more general categories | information about this item |  | 
| | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  |  |  |
 |
 | 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |  | 
|  | Milk (61) |  | 
|  | Cattle, fat (61) |  | 
|  | Cattle, kidney (13) |  | 
|  | Cattle, meat (59) |  | 
|  | Cattle, meat byproducts (except kidney) (5) |  | 
|  | Goat, fat (57) |  | 
|  | Goat, kidney (12) |  | 
|  | Goat, meat (56) |  | 
|  | Goat, meat byproducts (except kidney) (5) |  | 
|  | Horse, fat (57) |  | 
|  | Horse, kidney (12) |  | 
|  | Horse, meat (54) |  | 
|  | Horse, meat byproducts (except kidney) (5) |  | 
|  | Sheep, fat (57) |  | 
|  | Sheep, kidney (12) |  | 
|  | Sheep, meat (56) |  | 
|  | Sheep, meat byproducts (except kidney) (5) |  | 
|  |  |  | 
|  |  |  | 
|  | Wheat, grain (22) |  | 
|  | Wheat, grain (22) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |  | 
|  | Wheat, forage (23) |  | 
|  | Wheat, straw (24) |  | 
|  |  |  | 
|  | Wheat, forage (23) |  | 
|  | Wheat, straw (24) |  | 
|  | Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |  | 
|  | 
| | 05. Industrial Uses |  |  |  |
 |
 | 05. Industrial Uses |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  | 
| | 08. Chemical Category |  |  |  |
 |
 | 08. Chemical Category |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  |  |  | 
|  | aminopyralid [CHEBI:62962] (1) |  | 
|  | 
| ChEBI Compound Accession Identifier: | [CHEBI:62962] | 
| ChEBI Compound Description: | An organochlorine pesticide having a 3,6-dichlorinated 4-aminopicolinic acid structure. | 
| ChEBI Compound Identification Number: | 62962 | 
| ChEBI InChI Value: | InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) | 
| ChEBI InChIKey Value: | NIXXQNOQHKNPEJ-UHFFFAOYSA-N | 
| ChEBI Compound Name: | aminopyralid | 
| ChEBI SMILES Value: | Nc1cc(Cl)nc(C(O)=O)c1Cl | 
| ChEBI Substance ID: | 126522732 | 
| ChEBI URL: | ChEBI:62962 | 
| ChemSpider ID: | 184712 | 
| Ontomatica Chemical Accession Key (OnChAKey): | NIXXQNOQHKNPEJ_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID: | 213012 |