| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Milk (61) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, kidney (13) | 
 | 
| 
 | 
 Cattle, liver (18) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, kidney (12) | 
 | 
| 
 | 
 Goat, liver (17) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, kidney (10) | 
 | 
| 
 | 
 Hog, liver (13) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, kidney (12) | 
 | 
| 
 | 
 Horse, liver (17) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, kidney (12) | 
 | 
| 
 | 
 Sheep, liver (17) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Avocado (23) | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Mango (18) | 
 | 
| 
 | 
 Papaya (20) | 
 | 
| 
 | 
 Persimmon (8) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5B : Leafy Brassica greens subgroup (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Snap bean (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean, succulent (18) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 11-10 : Pome Fruit Group (5) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Pear, Asian (1) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pistachio (28) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 buprofezin [CHEBI:3218] (3) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:3218] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 3218 | 
| ChEBI InChI Value:  | 
 InChI=1S/C16H23N3OS/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 | 
| ChEBI InChIKey Value:  | 
 PRLVTUNWOQKEAI-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 buprofezin | 
| ChEBI SMILES Value:  | 
 CC(C)N1C(=O)N(CSC1=NC(C)(C)C)c1ccccc1 | 
| ChEBI Substance ID:  | 
 26676098 | 
| ChEBI URL:  | 
 ChEBI:3218 | 
| ChemSpider ID:  | 
 NS | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 PRLVTUNWOQKEAI_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 50367 |