| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Poultry, meat (32) | 
 | 
| 
 | 
 Poultry, meat byproducts (32) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Asparagus (23) | 
 | 
| 
 | 
 Avocado (23) | 
 | 
| 
 | 
 Fig (12) | 
 | 
| 
 | 
 Mango (18) | 
 | 
| 
 | 
 Papaya (20) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 Watercress (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Sugar beet, root (20) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Horseradish (3) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Salsify, root (2) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Horseradish (3) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Salsify, root (2) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Chayote, root (2) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Chayote, root (2) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 Sugar beet, leaves (19) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Garlic, bulb (3) | 
 | 
| 
 | 
 Leek (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Garlic, bulb (3) | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Shallot, bulb (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Leek (3) | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pea (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean, succulent (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Pepper (15) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Okra (17) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Pumpkin (8) | 
 | 
| 
 | 
 Squash, winter (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Kumquat (1) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Lime (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 Tangerine (7) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Lime (2) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 Tangerine (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Lime (2) | 
 | 
| 
 | 
 Kumquat (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Quince (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Quince (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blackberry (5) | 
 | 
| 
 | 
 Raspberry (7) | 
 | 
| 
 | 
 Loganberry (4) | 
 | 
| 
 | 
 Boysenberry (4) | 
 | 
| 
 | 
 Dewberry (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 Currant (5) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blackberry (5) | 
 | 
| 
 | 
 Loganberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Chestnut (3) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Chestnut (3) | 
 | 
| 
 | 
 Pecan (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 Barley, grain (18) | 
 | 
| 
 | 
 Rice, grain (19) | 
 | 
| 
 | 
 Rye, grain (5) | 
 | 
| 
 | 
 Wheat, grain (22) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Oat, forage (13) | 
 | 
| 
 | 
 Rye, forage (8) | 
 | 
| 
 | 
 Wheat, forage (23) | 
 | 
| 
 | 
 Barley, straw (16) | 
 | 
| 
 | 
 Oat, straw (14) | 
 | 
| 
 | 
 Rye, straw (8) | 
 | 
| 
 | 
 Wheat, straw (24) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Clover, forage (7) | 
 | 
| 
 | 
 Cowpea, forage (5) | 
 | 
| 
 | 
 Soybean, forage (17) | 
 | 
| 
 | 
 Trefoil, forage (3) | 
 | 
| 
 | 
 Clover, hay (7) | 
 | 
| 
 | 
 Cowpea, hay (6) | 
 | 
| 
 | 
 Lespedeza, hay (1) | 
 | 
| 
 | 
 Peanut, hay (19) | 
 | 
| 
 | 
 Soybean, hay (17) | 
 | 
| 
 | 
 Trefoil, hay (3) | 
 | 
| 
 | 
 Vetch, hay (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Alfalfa (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Clover, forage (7) | 
 | 
| 
 | 
 Trefoil, forage (3) | 
 | 
| 
 | 
 Clover, hay (7) | 
 | 
| 
 | 
 Lespedeza, hay (1) | 
 | 
| 
 | 
 Trefoil, hay (3) | 
 | 
| 
 | 
 Vetch, hay (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sunflower, seed (16) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
| 
 | 
 malathion [CHEBI:6651] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:6651] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 6651 | 
| ChEBI InChI Value:  | 
 InChI=1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3 | 
| ChEBI InChIKey Value:  | 
 JXSJBGJIGXNWCI-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 malathion | 
| ChEBI SMILES Value:  | 
 CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC | 
| ChEBI Substance ID:  | 
 11533337 | 
| ChEBI URL:  | 
 ChEBI:6651 | 
| ChemSpider ID:  | 
 NS | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 JXSJBGJIGXNWCI_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 4004 |