more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Peanut (30) |
|
|
|
|
|
|
|
|
Bean, dried (3) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
|
|
|
|
|
|
Cowpea, forage (5) |
|
|
Cowpea, hay (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 18 : Nongrass Animal Feeds (Forage, Fodder, Straw & Hay) Group (11) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
alachlor [CHEBI:2533] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:2533] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
2533 |
ChEBI InChI Value: |
InChI=1S/C14H20ClNO2/c1-4-11-7-6-8-12(5-2)14(11)16(10-18-3)13(17)9-15/h6-8H,4-5,9-10H2,1-3H3 |
ChEBI InChIKey Value: |
XCSGPAVHZFQHGE-UHFFFAOYSA-N |
ChEBI Compound Name: |
alachlor |
ChEBI SMILES Value: |
CCc1cccc(CC)c1N(COC)C(=O)CCl |
ChEBI Substance ID: |
8146425 |
ChEBI URL: |
ChEBI:2533 |
ChemSpider ID: |
1994 |
Ontomatica Chemical Accession Key (OnChAKey): |
XCSGPAVHZFQHGE_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
2078 |