| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Banana (25) | 
 | 
| 
 | 
 Fig (12) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 Watercress (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Ginseng (6) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Ginseng (6) | 
 | 
| 
 | 
 Radish, root (6) | 
 | 
| 
 | 
 Rutabaga, root (5) | 
 | 
| 
 | 
 Turnip, root (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 Onion, bulb (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 Onion, green (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 Endive (6) | 
 | 
| 
 | 
 Lettuce (6) | 
 | 
| 
 | 
 Spinach (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Swiss chard (6) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Snap bean (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lima bean (green) (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Pepper (15) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Squash, winter (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 Cranberry (27) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 diazinon [CHEBI:34682] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:34682] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 34682 | 
| ChEBI InChI Value:  | 
 InChI=1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 | 
| ChEBI InChIKey Value:  | 
 FHIVAFMUCKRCQO-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 diazinon | 
| ChEBI SMILES Value:  | 
 CCOP(=S)(OCC)Oc1cc(C)nc(n1)C(C)C | 
| ChEBI Substance ID:  | 
 24775713 | 
| ChEBI URL:  | 
 ChEBI:34682 | 
| ChemSpider ID:  | 
 2909 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 FHIVAFMUCKRCQO_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 3017 |