| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Poultry, meat (32) | 
 | 
| 
 | 
 Poultry, meat byproducts (32) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Fig (12) | 
 | 
| 
 | 
 Mango (18) | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean (14) | 
 | 
| 
 | 
 Pea (5) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Muskmelon (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Crabapple (3) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Crabapple (3) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blackberry (5) | 
 | 
| 
 | 
 Raspberry (7) | 
 | 
| 
 | 
 Loganberry (4) | 
 | 
| 
 | 
 Boysenberry (4) | 
 | 
| 
 | 
 Dewberry (2) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 Currant (5) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blackberry (5) | 
 | 
| 
 | 
 Loganberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Gooseberry (4) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Coconut (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Barley, grain (18) | 
 | 
| 
 | 
 Buckwheat, grain (2) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 piperonyl butoxide [CHEBI:32687] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:32687] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 32687 | 
| ChEBI InChI Value:  | 
 InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3 | 
| ChEBI InChIKey Value:  | 
 FIPWRIJSWJWJAI-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 piperonyl butoxide | 
| ChEBI SMILES Value:  | 
 CCCCOCCOCCOCc1cc2OCOc2cc1CCC | 
| ChEBI Substance ID:  | 
 8147550 | 
| ChEBI URL:  | 
 ChEBI:32687 | 
| ChemSpider ID:  | 
 NS | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 FIPWRIJSWJWJAI_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 5794 |