| more general categories |
information about this item |
|
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
Egg (37) |
|
|
|
Milk (61) |
|
|
|
Cattle, fat (61) |
|
|
|
Cattle, meat (59) |
|
|
|
Cattle, meat byproducts (57) |
|
|
|
Goat, fat (57) |
|
|
|
Goat, meat (56) |
|
|
|
Goat, meat byproducts (55) |
|
|
|
Horse, fat (57) |
|
|
|
Horse, meat (54) |
|
|
|
Horse, meat byproducts (55) |
|
|
|
Poultry, fat (34) |
|
|
|
Poultry, meat (32) |
|
|
|
Poultry, meat byproducts (32) |
|
|
|
Sheep, fat (57) |
|
|
|
Sheep, meat (56) |
|
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1B : Root vegetables (except sugar beet) subgroup (8) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
|
Potato (33) |
|
|
|
Potato (33) |
|
|
|
|
|
|
|
Radish, leaves (7) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) |
|
|
|
|
|
|
|
Spinach (9) |
|
|
|
Spinach (9) |
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5B : Leafy Brassica greens subgroup (18) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
|
|
Okra (17) |
|
|
|
|
|
|
|
Okra (17) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
|
|
|
|
|
Cucumber (12) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |
|
|
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 20 Subgroup 20A : Rapeseed subgroup (4) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
flonicamid [CHEBI:39291] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
flonicamid [CHEBI:39291] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
flonicamid [CHEBI:39291] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
flonicamid [CHEBI:39291] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:39291] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
39291 |
| ChEBI InChI Value: |
InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| ChEBI InChIKey Value: |
RLQJEEJISHYWON-UHFFFAOYSA-N |
| ChEBI Compound Name: |
flonicamid |
| ChEBI SMILES Value: |
FC(F)(F)c1ccncc1C(=O)NCC#N |
| ChEBI Substance ID: |
26675768 |
| ChEBI URL: |
ChEBI:39291 |
| ChemSpider ID: |
8010234 |
| Ontomatica Chemical Accession Key (OnChAKey): |
RLQJEEJISHYWON_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
9834513 |