more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
![](pixel.gif) |
![](pixel.gif) |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Cattle, fat (61) |
|
|
|
|
|
Banana (25) |
|
|
Fig (12) |
|
|
Pineapple (16) |
|
|
Watercress (7) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Carrot, root (11) |
|
|
Ginseng (6) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Turnip, root (12) |
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Carrot, root (11) |
|
|
Ginseng (6) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Turnip, root (12) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Onion, bulb (12) |
|
|
|
|
|
Onion, green (10) |
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Spinach (9) |
|
|
Endive (6) |
|
|
Lettuce (6) |
|
|
Spinach (9) |
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
Swiss chard (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
|
|
|
|
|
|
|
|
|
Lima bean (green) (4) |
|
|
|
|
|
Tomato (20) |
|
|
Pepper (15) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Cucumber (12) |
|
|
Squash, winter (7) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
Apricot (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Prune plum (18) |
|
|
Apricot (11) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
![](pixel.gif) |
03. Biological Effects of Specific Chemicals |
![](pixel.gif) |
![](pixel.gif) |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
diazinon [CHEBI:34682] (1) |
|
![](pixel.gif) |
05. Industrial Uses |
![](pixel.gif) |
![](pixel.gif) |
|
05. Industrial Uses |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
diazinon [CHEBI:34682] (1) |
|
|
diazinon [CHEBI:34682] (1) |
|
![](pixel.gif) |
08. Chemical Category |
![](pixel.gif) |
![](pixel.gif) |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
|
|
|
|
diazinon [CHEBI:34682] (1) |
|
![](pixel.gif) |
ChEBI Compound Accession Identifier: |
[CHEBI:34682] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
34682 |
ChEBI InChI Value: |
InChI=1S/C12H21N2O3PS/c1-6-15-18(19,16-7-2)17-11-8-10(5)13-12(14-11)9(3)4/h8-9H,6-7H2,1-5H3 |
ChEBI InChIKey Value: |
FHIVAFMUCKRCQO-UHFFFAOYSA-N |
ChEBI Compound Name: |
diazinon |
ChEBI SMILES Value: |
CCOP(=S)(OCC)Oc1cc(C)nc(n1)C(C)C |
ChEBI Substance ID: |
24775713 |
ChEBI URL: |
ChEBI:34682 |
ChemSpider ID: |
2909 |
Ontomatica Chemical Accession Key (OnChAKey): |
FHIVAFMUCKRCQO_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
3017 |