more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except kidney) (5) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except kidney) (5) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except kidney) (5) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except kidney) (5) |
|
|
|
|
|
|
|
|
Wheat, grain (22) |
|
|
Wheat, grain (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
aminopyralid [CHEBI:62962] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:62962] |
ChEBI Compound Description: |
An organochlorine pesticide having a 3,6-dichlorinated 4-aminopicolinic acid structure. |
ChEBI Compound Identification Number: |
62962 |
ChEBI InChI Value: |
InChI=1S/C6H4Cl2N2O2/c7-3-1-2(9)4(8)5(10-3)6(11)12/h1H,(H2,9,10)(H,11,12) |
ChEBI InChIKey Value: |
NIXXQNOQHKNPEJ-UHFFFAOYSA-N |
ChEBI Compound Name: |
aminopyralid |
ChEBI SMILES Value: |
Nc1cc(Cl)nc(C(O)=O)c1Cl |
ChEBI Substance ID: |
126522732 |
ChEBI URL: |
ChEBI:62962 |
ChemSpider ID: |
184712 |
Ontomatica Chemical Accession Key (OnChAKey): |
NIXXQNOQHKNPEJ_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
213012 |