more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Asparagus (23) |
|
|
Banana (25) |
|
|
Fig (12) |
|
|
Peanut (30) |
|
|
|
|
|
|
|
|
Radish, root (6) |
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Turnip, root (12) |
|
|
|
|
|
Radish, root (6) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Turnip, root (12) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Onion, bulb (12) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) |
|
|
|
|
|
Pepper (15) |
|
|
|
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Prune plum (18) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Wheat, grain (22) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Alfalfa (21) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
chlorpyrifos [CHEBI:34631] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:34631] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
34631 |
ChEBI InChI Value: |
InChI=1S/C9H11Cl3NO3PS/c1-3-14-17(18,15-4-2)16-9-7(11)5-6(10)8(12)13-9/h5H,3-4H2,1-2H3 |
ChEBI InChIKey Value: |
SBPBAQFWLVIOKP-UHFFFAOYSA-N |
ChEBI Compound Name: |
chlorpyrifos |
ChEBI SMILES Value: |
CCOP(=S)(OCC)Oc1nc(Cl)c(Cl)cc1Cl |
ChEBI Substance ID: |
24775716 |
ChEBI URL: |
ChEBI:34631 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
SBPBAQFWLVIOKP_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
2730 |