more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Fig (12) |
|
|
Mango (18) |
|
|
Peanut (30) |
|
|
Pineapple (16) |
|
|
|
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
|
|
|
|
|
|
Bean (14) |
|
|
Pea (5) |
|
|
|
|
|
Tomato (20) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Muskmelon (3) |
|
|
|
|
|
Orange (7) |
|
|
|
|
|
Orange (7) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Crabapple (3) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Crabapple (3) |
|
|
Pear (21) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
|
|
|
Prune plum (18) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
Raspberry (7) |
|
|
Loganberry (4) |
|
|
Boysenberry (4) |
|
|
Dewberry (2) |
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
Currant (5) |
|
|
Gooseberry (4) |
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
Loganberry (4) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Coconut (3) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Barley, grain (18) |
|
|
Buckwheat, grain (2) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
|
|
|
|
|
|
|
piperonyl butoxide [CHEBI:32687] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:32687] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
32687 |
ChEBI InChI Value: |
InChI=1S/C19H30O5/c1-3-5-7-20-8-9-21-10-11-22-14-17-13-19-18(23-15-24-19)12-16(17)6-4-2/h12-13H,3-11,14-15H2,1-2H3 |
ChEBI InChIKey Value: |
FIPWRIJSWJWJAI-UHFFFAOYSA-N |
ChEBI Compound Name: |
piperonyl butoxide |
ChEBI SMILES Value: |
CCCCOCCOCCOCc1cc2OCOc2cc1CCC |
ChEBI Substance ID: |
8147550 |
ChEBI URL: |
ChEBI:32687 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
FIPWRIJSWJWJAI_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
5794 |