more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except liver) (9) |
|
|
Goat, fat (57) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except liver) (9) |
|
|
Hog, fat (44) |
|
|
Hog, liver (13) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (except liver) (6) |
|
|
Horse, fat (57) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except liver) (9) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except liver) (9) |
|
|
|
|
|
|
|
|
|
|
|
Bean, succulent (18) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 Subgroup 13A : Caneberry (blackberry & raspberry) subgroup (5) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Strawberry (23) |
|
|
|
|
|
Pecan (13) |
|
|
Butternut (2) |
|
|
Chestnut (3) |
|
|
Pecan (13) |
|
|
|
|
|
Pecan (13) |
|
|
Butternut (2) |
|
|
Chestnut (3) |
|
|
Pecan (13) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dicofol [CHEBI:34692] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dicofol [CHEBI:34692] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dicofol [CHEBI:34692] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
dicofol [CHEBI:34692] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:34692] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
34692 |
ChEBI InChI Value: |
InChI=1S/C14H9Cl5O/c15-11-5-1-9(2-6-11)13(20,14(17,18)19)10-3-7-12(16)8-4-10/h1-8,20H |
ChEBI InChIKey Value: |
UOAMTSKGCBMZTC-UHFFFAOYSA-N |
ChEBI Compound Name: |
dicofol |
ChEBI SMILES Value: |
OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
ChEBI Substance ID: |
26675687 |
ChEBI URL: |
ChEBI:34692 |
ChemSpider ID: |
7970 |
Ontomatica Chemical Accession Key (OnChAKey): |
UOAMTSKGCBMZTC_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
8268 |