more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except liver) (9) |
|
|
Goat, fat (57) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except liver) (9) |
|
|
Hog, fat (44) |
|
|
Hog, liver (13) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (except liver) (6) |
|
|
Horse, fat (57) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except liver) (9) |
|
|
Poultry, fat (34) |
|
|
Poultry, liver (8) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (except liver) (4) |
|
|
Sheep, fat (57) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except liver) (9) |
|
|
|
|
|
Avocado (23) |
|
|
Globe Artichoke (19) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Peanut (30) |
|
|
|
|
|
|
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1B : Root vegetables (except sugar beet) subgroup (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 03-07 Subgroup 3-07A : Onion, bulb, subgroup (7) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 03-07 Subgroup 3-07B : Onion, green, subgroup (6) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4A : Leafy greens subgroup (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4B : Leaf petioles subgroup (10) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5B : Leafy Brassica greens subgroup (18) |
|
|
|
|
|
Soybean (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6A : Edible-podded legume vegetables subgroup (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6B : Succulent shelled pea & bean subgroup (6) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 07 Subgroup 7A : Foliage of legume vegetables (except soybeans) subgroup (4) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
|
|
|
Prune plum (18) |
|
|
Prune plum (18) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07B : Bushberry subgroup (13) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
|
|
|
Soybean, forage (17) |
|
|
Peanut, hay (19) |
|
|
Soybean, hay (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 18 : Nongrass Animal Feeds (Forage, Fodder, Straw & Hay) Group (11) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 19 Subgroup 19A : Herb subgroup (8) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methoxyfenozide [CHEBI:38449] (1) |
|
|
|
|
|
|
|
|
methoxyfenozide [CHEBI:38449] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methoxyfenozide [CHEBI:38449] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:38449] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
38449 |
ChEBI InChI Value: |
InChI=1S/C22H28N2O3/c1-14-11-15(2)13-17(12-14)21(26)24(22(4,5)6)23-20(25)18-9-8-10-19(27-7)16(18)3/h8-13H,1-7H3,(H,23,25) |
ChEBI InChIKey Value: |
QCAWEPFNJXQPAN-UHFFFAOYSA-N |
ChEBI Compound Name: |
methoxyfenozide |
ChEBI SMILES Value: |
COc1cccc(C(=O)NN(C(=O)c2cc(C)cc(C)c2)C(C)(C)C)c1C |
ChEBI Substance ID: |
24775781 |
ChEBI URL: |
ChEBI:38449 |
ChemSpider ID: |
94755 |
Ontomatica Chemical Accession Key (OnChAKey): |
QCAWEPFNJXQPAN_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
105010 |