more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except kidney) (5) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except kidney) (5) |
|
|
Hog, fat (44) |
|
|
Hog, kidney (10) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (except kidney) (3) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except kidney) (5) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except kidney) (5) |
|
|
|
|
|
Asparagus (23) |
|
|
Banana (25) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Peanut (30) |
|
|
Persimmon (8) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
Ginseng (6) |
|
|
Horseradish (3) |
|
|
Parsnip, root (2) |
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
Ginseng (6) |
|
|
Horseradish (3) |
|
|
Parsnip, root (2) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Yam, true, root (3) |
|
|
|
|
|
Yam, true, root (3) |
|
|
|
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Onion, bulb (12) |
|
|
|
|
|
Onion, green (10) |
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
Rhubarb (3) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 Subgroup 5A : Head & stem Brassica subgroup (20) |
|
|
|
|
|
Soybean (8) |
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
|
|
|
Pea (edible podded) (1) |
|
|
|
|
|
Lentil (1) |
|
|
|
|
|
Tomato (20) |
|
|
Tomato (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
Plum (7) |
|
|
Apricot (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
Plum (7) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
Apricot (11) |
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
|
|
|
|
|
|
Cranberry (27) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
chlorothalonil [CHEBI:3639] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorothalonil [CHEBI:3639] (1) |
|
|
|
|
|
|
|
|
chlorothalonil [CHEBI:3639] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorothalonil [CHEBI:3639] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
chlorothalonil [CHEBI:3639] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:3639] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
3639 |
ChEBI InChI Value: |
InChI=1S/C8Cl4N2/c9-5-3(1-13)6(10)8(12)7(11)4(5)2-14 |
ChEBI InChIKey Value: |
CRQQGFGUEAVUIL-UHFFFAOYSA-N |
ChEBI Compound Name: |
chlorothalonil |
ChEBI SMILES Value: |
Clc1c(Cl)c(C#N)c(Cl)c(C#N)c1Cl |
ChEBI Substance ID: |
24712292 |
ChEBI URL: |
ChEBI:3639 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
CRQQGFGUEAVUIL_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
15910 |