more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, kidney (13) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except kidney) (5) |
|
|
Goat, fat (57) |
|
|
Goat, kidney (12) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except kidney) (5) |
|
|
Hog, fat (44) |
|
|
Hog, kidney (10) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (except kidney) (3) |
|
|
Horse, fat (57) |
|
|
Horse, kidney (12) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except kidney) (5) |
|
|
Sheep, fat (57) |
|
|
Sheep, kidney (12) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except kidney) (5) |
|
|
|
|
|
Asparagus (23) |
|
|
Avocado (23) |
|
|
Banana (25) |
|
|
Fig (12) |
|
|
Globe Artichoke (19) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Pawpaw (4) |
|
|
Peanut (30) |
|
|
Persimmon (8) |
|
|
Pineapple (16) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Carrot, root (11) |
|
|
Turnip, root (12) |
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
Turnip, root (12) |
|
|
|
|
|
Potato (33) |
|
|
Ginger (2) |
|
|
Potato (33) |
|
|
Yam, true, root (3) |
|
|
|
|
|
Ginger (2) |
|
|
Yam, true, root (3) |
|
|
|
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Onion, bulb (12) |
|
|
|
|
|
Onion, green (10) |
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Endive (6) |
|
|
Lettuce (6) |
|
|
|
|
|
Rhubarb (3) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6A : Edible-podded legume vegetables subgroup (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6B : Succulent shelled pea & bean subgroup (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 : Berries Group (7) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
|
|
|
|
Rice, grain (19) |
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Barley, grain (18) |
|
|
Rice, grain (19) |
|
|
Wheat, grain (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Barley, straw (16) |
|
|
Wheat, straw (24) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
|
|
|
Cowpea, forage (5) |
|
|
Soybean, forage (17) |
|
|
Cowpea, hay (6) |
|
|
Peanut, hay (19) |
|
|
Soybean, hay (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 18 : Nongrass Animal Feeds (Forage, Fodder, Straw & Hay) Group (11) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
paraquat [CHEBI:34905] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
paraquat [CHEBI:34905] (1) |
|
|
|
|
|
paraquat [CHEBI:34905] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
paraquat [CHEBI:34905] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:34905] |
ChEBI Compound Description: |
An organic cation that consists of 4,4'-bipyridine bearing two N-methyl substituents loctated at the 1- and 1'-positions. |
ChEBI Compound Identification Number: |
34905 |
ChEBI InChI Value: |
InChI=1S/C12H14N2/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12/h3-10H,1-2H3/q+2 |
ChEBI InChIKey Value: |
INFDPOAKFNIJBF-UHFFFAOYSA-N |
ChEBI Compound Name: |
paraquat |
ChEBI SMILES Value: |
C[n+]1ccc(cc1)-c1cc[n+](C)cc1 |
ChEBI Substance ID: |
11533728 |
ChEBI URL: |
ChEBI:34905 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
INFDPOAKFNIJBF_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
15939 |