more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Oyster (1) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Asparagus (23) |
|
|
Banana (25) |
|
|
Peanut (30) |
|
|
Pineapple (16) |
|
|
|
|
|
|
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1B : Root vegetables (except sugar beet) subgroup (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Sweet potato, root (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) |
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
|
|
|
Spinach (9) |
|
|
Endive (6) |
|
|
Lettuce (6) |
|
|
Spinach (9) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4B : Leaf petioles subgroup (10) |
|
|
|
|
|
|
|
|
Broccoli (15) |
|
|
Cauliflower (13) |
|
|
Cabbage (13) |
|
|
Broccoli (15) |
|
|
Broccoli, Chinese (3) |
|
|
Brussels sprouts (12) |
|
|
Cabbage (13) |
|
|
Cabbage, Chinese (napa) (3) |
|
|
Cabbage, Chinese mustard (3) |
|
|
Cauliflower (13) |
|
|
Cavalo broccolo (3) |
|
|
Kohlrabi (5) |
|
|
|
|
|
Mustard greens (9) |
|
|
Broccoli raab (2) |
|
|
Cabbage, Chinese (bok choy) (2) |
|
|
Collards (8) |
|
|
Kale (7) |
|
|
Mizuna (2) |
|
|
Mustard greens (9) |
|
|
Mustard spinach (2) |
|
|
Rape greens (2) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6A : Edible-podded legume vegetables subgroup (8) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 07 Subgroup 7A : Foliage of legume vegetables (except soybeans) subgroup (4) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07B : Bushberry subgroup (13) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Brazil nut (1) |
|
|
Butternut (2) |
|
|
Cashew (1) |
|
|
Chestnut (3) |
|
|
Chinquapin (1) |
|
|
Hickory nut (1) |
|
|
Pecan (13) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
African nut-tree (1) |
|
|
Almond (46) |
|
|
Beechnut (1) |
|
|
Brazil nut (1) |
|
|
Brazilian pine (1) |
|
|
Bunya (1) |
|
|
Bur oak (1) |
|
|
Butternut (2) |
|
|
Cajou nut (1) |
|
|
Candlenut (1) |
|
|
Cashew (1) |
|
|
Chestnut (3) |
|
|
Chinquapin (1) |
|
|
Coconut (3) |
|
|
Coquito nut (1) |
|
|
Dika nut (1) |
|
|
Ginkgo (1) |
|
|
Guiana chestnut (1) |
|
|
Hazelnut (Filbert) (1) |
|
|
Heartnut (1) |
|
|
Hickory nut (1) |
|
|
Japanese horse-chestnut (1) |
|
|
Macadamia nut (1) |
|
|
Mongongo nut (1) |
|
|
Monkey-pot (1) |
|
|
Monkey puzzle nut (1) |
|
|
Okari nut (1) |
|
|
Pachira nut (1) |
|
|
Peach palm nut (1) |
|
|
Pecan (13) |
|
|
Pequi (1) |
|
|
Pili nut (1) |
|
|
Pine nut (1) |
|
|
Pistachio (28) |
|
|
Sapucaia nut (1) |
|
|
Tropical almond (1) |
|
|
Yellowhorn (1) |
|
|
|
|
|
Rice, grain (19) |
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Millet, proso, grain (1) |
|
|
Rice, grain (19) |
|
|
Wheat, grain (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
|
|
|
Clover, forage (7) |
|
|
Soybean, forage (17) |
|
|
Trefoil, forage (3) |
|
|
Clover, hay (7) |
|
|
Peanut, hay (19) |
|
|
Soybean, hay (17) |
|
|
Trefoil, hay (3) |
|
|
|
|
|
Alfalfa (21) |
|
|
|
|
|
Clover, forage (7) |
|
|
Trefoil, forage (3) |
|
|
Clover, hay (7) |
|
|
Trefoil, hay (3) |
|
|
|
|
|
|
|
|
Dillweed (2) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
carbaryl [CHEBI:3390] (1) |
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
carbaryl [CHEBI:3390] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
carbaryl [CHEBI:3390] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:3390] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
3390 |
ChEBI InChI Value: |
InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
ChEBI InChIKey Value: |
CVXBEEMKQHEXEN-UHFFFAOYSA-N |
ChEBI Compound Name: |
carbaryl |
ChEBI SMILES Value: |
CNC(=O)Oc1cccc2ccccc12 |
ChEBI Substance ID: |
24775873 |
ChEBI URL: |
ChEBI:3390 |
ChemSpider ID: |
5899 |
Ontomatica Chemical Accession Key (OnChAKey): |
CVXBEEMKQHEXEN_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
6129 |