| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 Egg (37) | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (57) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (55) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (41) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (55) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Poultry, fat (34) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (55) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peanut (30) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Orange (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Lemon (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 Grapefruit (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 Grape (40) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sorghum, grain (28) | 
 | 
| 
 | 
 Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 propargite [CHEBI:39300] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:39300] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 39300 | 
| ChEBI InChI Value:  | 
 InChI=1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3 | 
| ChEBI InChIKey Value:  | 
 ZYHMJXZULPZUED-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 propargite | 
| ChEBI SMILES Value:  | 
 CC(C)(C)c1ccc(OC2CCCCC2OS(=O)OCC#C)cc1 | 
| ChEBI Substance ID:  | 
 26675754 | 
| ChEBI URL:  | 
 ChEBI:39300 | 
| ChemSpider ID:  | 
 4767 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 ZYHMJXZULPZUED_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 4936 |