more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
![](pixel.gif) |
![](pixel.gif) |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Avocado (23) |
|
|
Fig (12) |
|
|
Papaya (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 : Berries Group (7) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
![](pixel.gif) |
05. Industrial Uses |
![](pixel.gif) |
![](pixel.gif) |
|
05. Industrial Uses |
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
![](pixel.gif) |
08. Chemical Category |
![](pixel.gif) |
![](pixel.gif) |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oryzalin [CHEBI:73163] (1) |
|
![](pixel.gif) |
ChEBI Compound Accession Identifier: |
[CHEBI:73163] |
ChEBI Compound Description: |
A sulfonamide that is benzenesulfonamide substituted at positions 3 and 5 by nitro groups and at position 4 by a dipropylamino group. |
ChEBI Compound Identification Number: |
73163 |
ChEBI InChI Value: |
InChI=1S/C12H18N4O6S/c1-3-5-14(6-4-2)12-10(15(17)18)7-9(23(13,21)22)8-11(12)16(19)20/h7-8H,3-6H2,1-2H3,(H2,13,21,22) |
ChEBI InChIKey Value: |
UNAHYJYOSSSJHH-UHFFFAOYSA-N |
ChEBI Compound Name: |
oryzalin |
ChEBI SMILES Value: |
CCCN(CCC)c1c(cc(cc1[N+]([O-])=O)S(N)(=O)=O)[N+]([O-])=O |
ChEBI Substance ID: |
162169331 |
ChEBI URL: |
ChEBI:73163 |
ChemSpider ID: |
27326 |
Ontomatica Chemical Accession Key (OnChAKey): |
UNAHYJYOSSSJHH_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
29393 |