more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Banana (25) |
|
|
Fig (12) |
|
|
Papaya (20) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
Turnip, root (12) |
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
Turnip, root (12) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
|
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
|
|
|
Endive (6) |
|
|
Lettuce (6) |
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
|
|
|
|
|
|
Broccoli (15) |
|
|
Cauliflower (13) |
|
|
Cabbage (13) |
|
|
Broccoli (15) |
|
|
Brussels sprouts (12) |
|
|
Cabbage (13) |
|
|
Cauliflower (13) |
|
|
Kohlrabi (5) |
|
|
|
|
|
Mustard greens (9) |
|
|
Collards (8) |
|
|
Kale (7) |
|
|
Mustard greens (9) |
|
|
|
|
|
|
|
|
Bean, succulent (18) |
|
|
|
|
|
Tomato (20) |
|
|
Eggplant (8) |
|
|
Pepper (15) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Squash, winter (7) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Peach (26) |
|
|
Apricot (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Apricot (11) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Cranberry (27) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
maneb [CHEBI:52497] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
maneb [CHEBI:52497] (1) |
|
|
|
|
|
maneb [CHEBI:52497] (1) |
|
|
|
|
|
maneb [CHEBI:52497] (1) |
|
|
|
|
|
|
|
|
|
|
|
maneb [CHEBI:52497] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:52497] |
ChEBI Compound Description: |
A polymeric complex of manganese with the ethylene bis(dithiocarbamate) anionic ligand. |
ChEBI Compound Identification Number: |
52497 |
ChEBI InChI Value: |
"InChI=1S/C4H8N2S4.Mn/c7-3(8)5-1-2-6-4(9)10;/h1-2H2,(H2,5,7,8)(H2,6,9,10);/q;+2/p-2" |
ChEBI InChIKey Value: |
YKSNLCVSTHTHJA-UHFFFAOYSA-L |
ChEBI Compound Name: |
maneb |
ChEBI SMILES Value: |
[Mn++].[S-]C(=S)NCCNC([S-])=S |
ChEBI Substance ID: |
81058831 |
ChEBI URL: |
ChEBI:52497 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
YKSNLCVSTHTHJA_UHFFFAOYSA_L_000_000000 |
PubChem Compound ID: |
3032581 |