more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, liver (8) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (except liver) (4) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Globe Artichoke (19) |
|
|
Peanut (30) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Turnip, root (12) |
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Turnip, root (12) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
Radish, leaves (7) |
|
|
|
|
|
|
|
|
Broccoli (15) |
|
|
Cauliflower (13) |
|
|
Cabbage (13) |
|
|
Broccoli (15) |
|
|
Cabbage (13) |
|
|
Cauliflower (13) |
|
|
Kohlrabi (5) |
|
|
|
|
|
Mustard greens (9) |
|
|
Collards (8) |
|
|
Mustard greens (9) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Snap bean (10) |
|
|
|
|
|
Tomato (20) |
|
|
Eggplant (8) |
|
|
Pepper (15) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Eggplant (8) |
|
|
Okra (17) |
|
|
|
|
|
Eggplant (8) |
|
|
Okra (17) |
|
|
|
|
|
|
|
|
Muskmelon (3) |
|
|
Watermelon (3) |
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Squash, winter (7) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 Subgroup 13A : Caneberry (blackberry & raspberry) subgroup (5) |
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
Elderberry (2) |
|
|
Gooseberry (4) |
|
|
|
|
|
|
|
|
Elderberry (2) |
|
|
Gooseberry (4) |
|
|
|
|
|
Elderberry (2) |
|
|
Elderberry (2) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
|
|
|
|
|
|
|
|
|
esfenvalerate [CHEBI:39346] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:39346] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
39346 |
ChEBI InChI Value: |
InChI=1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m1/s1 |
ChEBI InChIKey Value: |
NYPJDWWKZLNGGM-RPWUZVMVSA-N |
ChEBI Compound Name: |
esfenvalerate |
ChEBI SMILES Value: |
CC(C)[C@H](C(=O)O[C@H](C#N)c1cccc(Oc2ccccc2)c1)c1ccc(Cl)cc1 |
ChEBI Substance ID: |
26675852 |
ChEBI URL: |
ChEBI:39346 |
ChemSpider ID: |
8517510 |
Ontomatica Chemical Accession Key (OnChAKey): |
NYPJDWWKZLNGGM_RPWUZVMVSA_N_000_000000 |
PubChem Compound ID: |
10342051 |