more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Cattle, fat (61) |
|
|
Cattle, liver (18) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (except liver) (9) |
|
|
Goat, fat (57) |
|
|
Goat, liver (17) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (except liver) (9) |
|
|
Hog, fat (44) |
|
|
Hog, liver (13) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (except liver) (6) |
|
|
Horse, fat (57) |
|
|
Horse, liver (17) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (except liver) (9) |
|
|
Milk, fat (24) |
|
|
Sheep, fat (57) |
|
|
Sheep, liver (17) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (except liver) (9) |
|
|
|
|
|
Pineapple (16) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
|
|
|
Carrot, root (11) |
|
|
Carrot, root (11) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
|
|
|
|
|
|
Broccoli (15) |
|
|
Cauliflower (13) |
|
|
Cabbage (13) |
|
|
Broccoli (15) |
|
|
Brussels sprouts (12) |
|
|
Cabbage (13) |
|
|
Cauliflower (13) |
|
|
|
|
|
Mustard greens (9) |
|
|
Collards (8) |
|
|
Kale (7) |
|
|
Mustard greens (9) |
|
|
|
|
|
|
|
|
Bean (14) |
|
|
|
|
|
Tomato (20) |
|
|
Eggplant (8) |
|
|
Pepper (15) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
|
|
|
Muskmelon (3) |
|
|
Watermelon (3) |
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Squash, winter (7) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Peach (26) |
|
|
Plum (7) |
|
|
Apricot (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
Plum (7) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
Apricot (11) |
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
|
|
|
|
|
|
Strawberry (23) |
|
|
Strawberry (23) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
endosulfan [CHEBI:4791] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
endosulfan [CHEBI:4791] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:4791] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
4791 |
ChEBI InChI Value: |
InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2 |
ChEBI InChIKey Value: |
RDYMFSUJUZBWLH-UHFFFAOYSA-N |
ChEBI Compound Name: |
endosulfan |
ChEBI SMILES Value: |
ClC1=C(Cl)C2(Cl)C3COS(=O)OCC3C1(Cl)C2(Cl)Cl |
ChEBI Substance ID: |
26676099 |
ChEBI URL: |
ChEBI:4791 |
ChemSpider ID: |
3111 |
Ontomatica Chemical Accession Key (OnChAKey): |
RDYMFSUJUZBWLH_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
3224 |