| more general categories |
information about this item |
|
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
|
|
Globe Artichoke (19) |
|
|
|
Mango (18) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
|
Tangerine (7) |
|
|
|
|
|
|
|
Tangerine (7) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
|
Almond (46) |
|
|
|
Almond (46) |
|
|
|
|
|
|
|
Almond (46) |
|
|
|
Almond (46) |
|
|
|
|
|
|
|
Sorghum, grain (28) |
|
|
|
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
 |
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
 |
| 05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
methidathion [CHEBI:34837] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
|
|
|
|
|
|
methidathion [CHEBI:34837] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:34837] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
34837 |
| ChEBI InChI Value: |
InChI=1S/C6H11N2O4PS3/c1-10-5-7-8(6(9)16-5)4-15-13(14,11-2)12-3/h4H2,1-3H3 |
| ChEBI InChIKey Value: |
MEBQXILRKZHVCX-UHFFFAOYSA-N |
| ChEBI Compound Name: |
methidathion |
| ChEBI SMILES Value: |
COc1nn(CSP(=S)(OC)OC)c(=O)s1 |
| ChEBI Substance ID: |
26675691 |
| ChEBI URL: |
ChEBI:34837 |
| ChemSpider ID: |
13115 |
| Ontomatica Chemical Accession Key (OnChAKey): |
MEBQXILRKZHVCX_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
13709 |