more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Fish (5) |
|
|
Milk (61) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Avocado (23) |
|
|
Banana (25) |
|
|
Globe Artichoke (19) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Peanut (30) |
|
|
Persimmon (8) |
|
|
Watercress (7) |
|
|
|
|
|
|
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1B : Root vegetables (except sugar beet) subgroup (8) |
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) |
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 03-07 Subgroup 3-07A : Onion, bulb, subgroup (7) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 03-07 Subgroup 3-07B : Onion, green, subgroup (6) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4A : Leafy greens subgroup (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 Subgroup 4B : Leaf petioles subgroup (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 : Legume Vegetables (Succulent or Dried) Group (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 06 Subgroup 6C : Dried shelled pea & bean (except soybean) subgroup (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 07 : Foliage of Legume Vegetables Group (9) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 12 : Stone Fruits Group (29) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13 Subgroup 13A : Caneberry (blackberry & raspberry) subgroup (5) |
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
Currant (5) |
|
|
Elderberry (2) |
|
|
Gooseberry (4) |
|
|
Huckleberry (1) |
|
|
|
|
|
|
|
|
Elderberry (2) |
|
|
Gooseberry (4) |
|
|
Huckleberry (1) |
|
|
Juneberry (2) |
|
|
Lingonberry (3) |
|
|
Salal (2) |
|
|
|
|
|
Elderberry (2) |
|
|
Elderberry (2) |
|
|
Juneberry (2) |
|
|
Salal (2) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Lingonberry (3) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
Lingonberry (3) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Pistachio (28) |
|
|
|
|
|
Rice, grain (19) |
|
|
Rice, grain (19) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
|
|
|
|
|
|
|
Soybean, forage (17) |
|
|
Peanut, hay (19) |
|
|
Soybean, hay (17) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 19 Subgroup 19A : Herb subgroup (8) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
imidacloprid [CHEBI:5870] (3) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:5870] |
ChEBI Compound Description: |
An imidazolidine that is N-nitroimidazolidin-2-imine bearing a (6-chloro-3-pyridinyl)methyl substituent at position 1. |
ChEBI Compound Identification Number: |
5870 |
ChEBI InChI Value: |
InChI=1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13) |
ChEBI InChIKey Value: |
YWTYJOPNNQFBPC-UHFFFAOYSA-N |
ChEBI Compound Name: |
imidacloprid |
ChEBI SMILES Value: |
[O-][N+](=O)N=C1NCCN1Cc1ccc(Cl)nc1 |
ChEBI Substance ID: |
26676108 |
ChEBI URL: |
ChEBI:5870 |
ChemSpider ID: |
0 |
Ontomatica Chemical Accession Key (OnChAKey): |
YWTYJOPNNQFBPC_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
86418 |