| more general categories    | 
information about this item | 
 | 
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities  | 
  | 
  | 
 
 
 
 
 | 
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cattle, fat (61) | 
 | 
| 
 | 
 Cattle, liver (18) | 
 | 
| 
 | 
 Cattle, meat (59) | 
 | 
| 
 | 
 Cattle, meat byproducts (except liver) (9) | 
 | 
| 
 | 
 Goat, fat (57) | 
 | 
| 
 | 
 Goat, liver (17) | 
 | 
| 
 | 
 Goat, meat (56) | 
 | 
| 
 | 
 Goat, meat byproducts (except liver) (9) | 
 | 
| 
 | 
 Hog, fat (44) | 
 | 
| 
 | 
 Hog, liver (13) | 
 | 
| 
 | 
 Hog, meat (42) | 
 | 
| 
 | 
 Hog, meat byproducts (except liver) (6) | 
 | 
| 
 | 
 Horse, fat (57) | 
 | 
| 
 | 
 Horse, liver (17) | 
 | 
| 
 | 
 Horse, meat (54) | 
 | 
| 
 | 
 Horse, meat byproducts (except liver) (9) | 
 | 
| 
 | 
 Milk, fat (24) | 
 | 
| 
 | 
 Sheep, fat (57) | 
 | 
| 
 | 
 Sheep, liver (17) | 
 | 
| 
 | 
 Sheep, meat (56) | 
 | 
| 
 | 
 Sheep, meat byproducts (except liver) (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Pineapple (16) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 Carrot, root (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Potato (33) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 Sweet potato, root (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 Celery (10) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Broccoli (15) | 
 | 
| 
 | 
 Brussels sprouts (12) | 
 | 
| 
 | 
 Cabbage (13) | 
 | 
| 
 | 
 Cauliflower (13) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 Collards (8) | 
 | 
| 
 | 
 Kale (7) | 
 | 
| 
 | 
 Mustard greens (9) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Bean (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 Pepper (15) | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Tomato (20) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Eggplant (8) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Muskmelon (3) | 
 | 
| 
 | 
 Watermelon (3) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cucumber (12) | 
 | 
| 
 | 
 Pumpkin (8) | 
 | 
| 
 | 
 Squash, winter (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 Apple (37) | 
 | 
| 
 | 
 Pear (21) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 Cherry, sweet (11) | 
 | 
| 
 | 
 Cherry, tart (11) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Peach (26) | 
 | 
| 
 | 
 Nectarine (14) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 Apricot (11) | 
 | 
| 
 | 
 Plum (7) | 
 | 
| 
 | 
 Prune plum (18) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Blueberry, highbush & lowbush (15) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 Strawberry (23) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 Almond (46) | 
 | 
| 
 | 
 Almond (46) | 
 | 
  | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
  | 
| 05. Industrial Uses  | 
  | 
  | 
 
 
 
 
 | 
05. Industrial Uses | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 endosulfan [CHEBI:4791] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:4791] | 
| ChEBI Compound Description:  | 
 null | 
| ChEBI Compound Identification Number:  | 
 4791 | 
| ChEBI InChI Value:  | 
 InChI=1S/C9H6Cl6O3S/c10-5-6(11)8(13)4-2-18-19(16)17-1-3(4)7(5,12)9(8,14)15/h3-4H,1-2H2 | 
| ChEBI InChIKey Value:  | 
 RDYMFSUJUZBWLH-UHFFFAOYSA-N | 
| ChEBI Compound Name:  | 
 endosulfan | 
| ChEBI SMILES Value:  | 
 ClC1=C(Cl)C2(Cl)C3COS(=O)OCC3C1(Cl)C2(Cl)Cl | 
| ChEBI Substance ID:  | 
 26676099 | 
| ChEBI URL:  | 
 ChEBI:4791 | 
| ChemSpider ID:  | 
 3111 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 RDYMFSUJUZBWLH_UHFFFAOYSA_N_000_000000 | 
| PubChem Compound ID:  | 
 3224 |