more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat (54) |
|
|
Horse, meat byproducts (55) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Peanut (30) |
|
|
|
|
|
|
|
|
Potato (33) |
|
|
Potato (33) |
|
|
|
|
|
Lemon (10) |
|
|
Grapefruit (10) |
|
|
Lemon (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Orange (7) |
|
|
Lemon (10) |
|
|
Grapefruit (10) |
|
|
|
|
|
Orange (7) |
|
|
|
|
|
Lemon (10) |
|
|
|
|
|
Grapefruit (10) |
|
|
Grapefruit (10) |
|
|
|
|
|
Nectarine (14) |
|
|
|
|
|
|
|
|
Nectarine (14) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 16 : Forage, Fodder & Straw of Cereal Grains Group (31) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
|
|
|
|
|
|
|
|
|
|
propargite [CHEBI:39300] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:39300] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
39300 |
ChEBI InChI Value: |
InChI=1S/C19H26O4S/c1-5-14-21-24(20)23-18-9-7-6-8-17(18)22-16-12-10-15(11-13-16)19(2,3)4/h1,10-13,17-18H,6-9,14H2,2-4H3 |
ChEBI InChIKey Value: |
ZYHMJXZULPZUED-UHFFFAOYSA-N |
ChEBI Compound Name: |
propargite |
ChEBI SMILES Value: |
CC(C)(C)c1ccc(OC2CCCCC2OS(=O)OCC#C)cc1 |
ChEBI Substance ID: |
26675754 |
ChEBI URL: |
ChEBI:39300 |
ChemSpider ID: |
4767 |
Ontomatica Chemical Accession Key (OnChAKey): |
ZYHMJXZULPZUED_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
4936 |