| more general categories |
information about this item |
|
| 02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
Milk (61) |
|
|
|
Cattle, fat (61) |
|
|
|
Cattle, liver (18) |
|
|
|
Cattle, meat (59) |
|
|
|
Cattle, meat byproducts (except liver) (9) |
|
|
|
Goat, fat (57) |
|
|
|
Goat, liver (17) |
|
|
|
Goat, meat (56) |
|
|
|
Goat, meat byproducts (except liver) (9) |
|
|
|
Hog, fat (44) |
|
|
|
Hog, liver (13) |
|
|
|
Hog, meat (42) |
|
|
|
Hog, meat byproducts (except liver) (6) |
|
|
|
Horse, fat (57) |
|
|
|
Horse, liver (17) |
|
|
|
Horse, meat (54) |
|
|
|
Horse, meat byproducts (except liver) (9) |
|
|
|
Poultry, fat (34) |
|
|
|
Poultry, meat (32) |
|
|
|
Poultry, meat byproducts (32) |
|
|
|
Sheep, fat (57) |
|
|
|
Sheep, liver (17) |
|
|
|
Sheep, meat (56) |
|
|
|
Sheep, meat byproducts (except liver) (9) |
|
|
|
|
|
|
|
Asparagus (23) |
|
|
|
Avocado (23) |
|
|
|
Peanut (30) |
|
|
|
|
|
|
|
Soybean (8) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
|
|
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
|
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
Apple (37) |
|
|
|
Pear (21) |
|
|
|
|
|
|
|
Peach (26) |
|
|
|
Apricot (11) |
|
|
|
Nectarine (14) |
|
|
|
Peach (26) |
|
|
|
|
|
|
|
|
|
|
|
Peach (26) |
|
|
|
Peach (26) |
|
|
|
Nectarine (14) |
|
|
|
|
|
|
|
Prune plum (18) |
|
|
|
Apricot (11) |
|
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
|
Raspberry (7) |
|
|
|
Blackberry (6) |
|
|
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
|
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
|
|
|
|
|
Grape (40) |
|
|
|
Grape (40) |
|
|
|
|
|
|
|
Grape (40) |
|
|
|
Grape (40) |
|
|
|
|
|
|
|
Cranberry (27) |
|
|
|
|
|
|
|
Cranberry (27) |
|
|
|
Cranberry (27) |
|
|
|
|
|
|
|
Almond (46) |
|
|
|
Pecan (13) |
|
|
|
Almond (46) |
|
|
|
Pecan (13) |
|
|
|
|
|
|
|
Almond (46) |
|
|
|
Pecan (13) |
|
|
|
Almond (46) |
|
|
|
Pecan (13) |
|
|
|
|
|
|
|
|
|
|
|
Soybean, forage (17) |
|
|
|
Peanut, hay (19) |
|
|
|
Soybean, hay (17) |
|
|
|
|
|
|
|
Alfalfa (21) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
norflurazon [CHEBI:50842] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:50842] |
| ChEBI Compound Description: |
null |
| ChEBI Compound Identification Number: |
50842 |
| ChEBI InChI Value: |
InChI=1S/C12H9ClF3N3O/c1-17-9-6-18-19(11(20)10(9)13)8-4-2-3-7(5-8)12(14,15)16/h2-6,17H,1H3 |
| ChEBI InChIKey Value: |
NVGOPFQZYCNLDU-UHFFFAOYSA-N |
| ChEBI Compound Name: |
norflurazon |
| ChEBI SMILES Value: |
CNc1cnn(-c2cccc(c2)C(F)(F)F)c(=O)c1Cl |
| ChEBI Substance ID: |
56352965 |
| ChEBI URL: |
ChEBI:50842 |
| ChemSpider ID: |
31131 |
| Ontomatica Chemical Accession Key (OnChAKey): |
NVGOPFQZYCNLDU_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
33775 |