more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Cattle, fat (61) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat byproducts (55) |
|
|
Horse, fat (57) |
|
|
Horse, meat byproducts (55) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Bean (edible-podded) (2) |
|
|
Bean (edible-podded) (2) |
|
|
|
|
|
Bean, succulent (18) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Okra (17) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 Subgroup 9A : Melon subgroup (5) |
|
|
|
|
|
Cucumber (12) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10-10 : Citrus Fruit Group (25) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 11 : Pome Fruits Group (26) |
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
|
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
Cherry, sweet (11) |
|
|
Cherry, tart (11) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07A : Caneberry subgroup (12) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07F : Small fruit vine climbing (except fuzzy kiwifruit) subgroup (9) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 13-07 Subgroup 13-07G : Low growing berry subgroup (13) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 14 : Tree Nuts Group (28) |
|
|
Almond (46) |
|
|
Almond (46) |
|
|
|
|
|
Almond (46) |
|
|
Almond (46) |
|
|
Pistachio (28) |
|
|
|
|
|
|
|
|
Cowpea, forage (5) |
|
|
Cowpea, hay (6) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
|
|
|
acequinocyl [CHEBI:38592] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:38592] |
ChEBI Compound Description: |
An acetate ester consisting of 1,4-naphthoquinone bearing acetoxy and dodecyl substituents at positions 2 and 3 respectively. |
ChEBI Compound Identification Number: |
38592 |
ChEBI InChI Value: |
InChI=1S/C24H32O4/c1-3-4-5-6-7-8-9-10-11-12-17-21-22(26)19-15-13-14-16-20(19)23(27)24(21)28-18(2)25/h13-16H,3-12,17H2,1-2H3 |
ChEBI InChIKey Value: |
QDRXWCAVUNHOGA-UHFFFAOYSA-N |
ChEBI Compound Name: |
acequinocyl |
ChEBI SMILES Value: |
CCCCCCCCCCCCC1=C(OC(C)=O)C(=O)c2ccccc2C1=O |
ChEBI Substance ID: |
24775808 |
ChEBI URL: |
ChEBI:38592 |
ChemSpider ID: |
84245 |
Ontomatica Chemical Accession Key (OnChAKey): |
QDRXWCAVUNHOGA_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
93315 |