more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
 |
 |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Asparagus (23) |
|
|
Avocado (23) |
|
|
Peanut (30) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 : Root & Tuber Vegetables Group (7) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 02 : Leaves of Root & Tuber Vegetables (Human Food or Animal Feed) Group (10) |
|
|
|
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Onion, green (10) |
|
|
Onion, green (10) |
|
|
|
|
|
|
|
|
Spinach (9) |
|
|
Endive (6) |
|
|
Lettuce (6) |
|
|
Spinach (9) |
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
Swiss chard (6) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
|
|
Broccoli (15) |
|
|
Cauliflower (13) |
|
|
Cabbage (13) |
|
|
Broccoli (15) |
|
|
Brussels sprouts (12) |
|
|
Cabbage (13) |
|
|
Cauliflower (13) |
|
|
|
|
|
Mustard greens (9) |
|
|
Collards (8) |
|
|
Kale (7) |
|
|
Mustard greens (9) |
|
|
|
|
|
|
|
|
Pea (5) |
|
|
|
|
|
Bean, succulent (18) |
|
|
|
|
|
Tomato (20) |
|
|
Tomato (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 08-10 : Fruiting Vegetable Group (34) |
|
|
|
|
|
Tomato (20) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 09 : Cucurbit Vegetables Group (29) |
|
|
|
|
|
Lemon (10) |
|
|
Grapefruit (10) |
|
|
Lemon (10) |
|
|
|
|
|
Orange (7) |
|
|
Tangerine (7) |
|
|
Lemon (10) |
|
|
Grapefruit (10) |
|
|
|
|
|
Orange (7) |
|
|
Tangerine (7) |
|
|
|
|
|
Lemon (10) |
|
|
|
|
|
Grapefruit (10) |
|
|
Grapefruit (10) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Apple (37) |
|
|
Apple (37) |
|
|
|
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
|
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
|
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Grape (40) |
|
|
Grape (40) |
|
|
|
|
|
Pecan (13) |
|
|
Pecan (13) |
|
|
|
|
|
Pecan (13) |
|
|
Pecan (13) |
|
|
|
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Barley, grain (18) |
|
|
Rye, grain (5) |
|
|
Wheat, grain (22) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Oat, forage (13) |
|
|
Rye, forage (8) |
|
|
Wheat, forage (23) |
|
|
Barley, straw (16) |
|
|
Oat, straw (14) |
|
|
Rye, straw (8) |
|
|
Wheat, straw (24) |
|
|
|
|
|
|
|
|
Bermuda grass, forage (1) |
|
|
Soybean, forage (17) |
|
|
|
|
|
Alfalfa (21) |
|
|
|
|
|
|
|
|
Pepper, black (3) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
methomyl [CHEBI:6835] (1) |
|
|
methomyl [CHEBI:6835] (1) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
methomyl [CHEBI:6835] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methomyl [CHEBI:6835] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:6835] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
6835 |
ChEBI InChI Value: |
InChI=1S/C5H10N2O2S/c1-4(10-3)7-9-5(8)6-2/h1-3H3,(H,6,8) |
ChEBI InChIKey Value: |
UHXUZOCRWCRNSJ-UHFFFAOYSA-N |
ChEBI Compound Name: |
methomyl |
ChEBI SMILES Value: |
CNC(=O)ON=C(C)SC |
ChEBI Substance ID: |
24775874 |
ChEBI URL: |
ChEBI:6835 |
ChemSpider ID: |
3966 |
Ontomatica Chemical Accession Key (OnChAKey): |
UHXUZOCRWCRNSJ_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
4109 |