more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
Egg (37) |
|
|
Cattle, fat (61) |
|
|
Cattle, meat (59) |
|
|
Cattle, meat byproducts (57) |
|
|
Goat, fat (57) |
|
|
Goat, meat (56) |
|
|
Goat, meat byproducts (55) |
|
|
Hog, fat (44) |
|
|
Hog, meat (42) |
|
|
Hog, meat byproducts (41) |
|
|
Horse, fat (57) |
|
|
Horse, meat byproducts (55) |
|
|
Milk, fat (24) |
|
|
Poultry, fat (34) |
|
|
Poultry, meat (32) |
|
|
Poultry, meat byproducts (32) |
|
|
Sheep, fat (57) |
|
|
Sheep, meat (56) |
|
|
Sheep, meat byproducts (55) |
|
|
|
|
|
Asparagus (23) |
|
|
Avocado (23) |
|
|
Fig (12) |
|
|
Mango (18) |
|
|
Papaya (20) |
|
|
Peanut (30) |
|
|
Pineapple (16) |
|
|
Watercress (7) |
|
|
|
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Sugar beet, root (20) |
|
|
Sugar beet, root (20) |
|
|
Carrot, root (11) |
|
|
Horseradish (3) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Salsify, root (2) |
|
|
Turnip, root (12) |
|
|
|
|
|
Carrot, root (11) |
|
|
Radish, root (6) |
|
|
Carrot, root (11) |
|
|
Horseradish (3) |
|
|
Radish, root (6) |
|
|
Rutabaga, root (5) |
|
|
Salsify, root (2) |
|
|
Turnip, root (12) |
|
|
|
|
|
Potato (33) |
|
|
Chayote, root (2) |
|
|
Potato (33) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sweet potato, root (8) |
|
|
Chayote, root (2) |
|
|
Sweet potato, root (8) |
|
|
|
|
|
Sugar beet, leaves (19) |
|
|
Sugar beet, leaves (19) |
|
|
|
|
|
Onion, green (10) |
|
|
Garlic, bulb (3) |
|
|
Leek (3) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Garlic, bulb (3) |
|
|
Onion, bulb (12) |
|
|
Shallot, bulb (2) |
|
|
|
|
|
Onion, green (10) |
|
|
Leek (3) |
|
|
Onion, green (10) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 04 : Leafy Vegetables (except Brassica Vegetables) Group (21) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 05 : Brassica (Cole) Leafy Vegetables Group (11) |
|
|
|
|
|
|
|
|
Pea (5) |
|
|
|
|
|
Bean, succulent (18) |
|
|
|
|
|
Tomato (20) |
|
|
Eggplant (8) |
|
|
Pepper (15) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Eggplant (8) |
|
|
Okra (17) |
|
|
|
|
|
Eggplant (8) |
|
|
Okra (17) |
|
|
|
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Squash, winter (7) |
|
|
|
|
|
Lemon (10) |
|
|
Grapefruit (10) |
|
|
Kumquat (1) |
|
|
Lemon (10) |
|
|
Lime (2) |
|
|
|
|
|
Orange (7) |
|
|
Tangerine (7) |
|
|
Lemon (10) |
|
|
Lime (2) |
|
|
Grapefruit (10) |
|
|
|
|
|
Orange (7) |
|
|
Tangerine (7) |
|
|
|
|
|
Lemon (10) |
|
|
Lime (2) |
|
|
Kumquat (1) |
|
|
|
|
|
Grapefruit (10) |
|
|
Grapefruit (10) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Quince (2) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Quince (2) |
|
|
|
|
|
Peach (26) |
|
|
Plum (7) |
|
|
Apricot (11) |
|
|
Nectarine (14) |
|
|
Peach (26) |
|
|
Plum (7) |
|
|
|
|
|
|
|
|
Peach (26) |
|
|
Peach (26) |
|
|
Nectarine (14) |
|
|
|
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
Apricot (11) |
|
|
Plum (7) |
|
|
Prune plum (18) |
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
Raspberry (7) |
|
|
Loganberry (4) |
|
|
Boysenberry (4) |
|
|
Dewberry (2) |
|
|
|
|
|
Blueberry, highbush & lowbush (15) |
|
|
Currant (5) |
|
|
Gooseberry (4) |
|
|
|
|
|
|
|
|
Blackberry (5) |
|
|
Loganberry (4) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Gooseberry (4) |
|
|
|
|
|
Grape (40) |
|
|
Gooseberry (4) |
|
|
Grape (40) |
|
|
|
|
|
Strawberry (23) |
|
|
Cranberry (27) |
|
|
Strawberry (23) |
|
|
|
|
|
Cranberry (27) |
|
|
Cranberry (27) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Chestnut (3) |
|
|
Pecan (13) |
|
|
|
|
|
Almond (46) |
|
|
Pecan (13) |
|
|
Almond (46) |
|
|
Chestnut (3) |
|
|
Pecan (13) |
|
|
|
|
|
Rice, grain (19) |
|
|
Sorghum, grain (28) |
|
|
Wheat, grain (22) |
|
|
Barley, grain (18) |
|
|
Rice, grain (19) |
|
|
Rye, grain (5) |
|
|
Wheat, grain (22) |
|
|
|
|
|
Wheat, forage (23) |
|
|
Wheat, straw (24) |
|
|
|
|
|
Oat, forage (13) |
|
|
Rye, forage (8) |
|
|
Wheat, forage (23) |
|
|
Barley, straw (16) |
|
|
Oat, straw (14) |
|
|
Rye, straw (8) |
|
|
Wheat, straw (24) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 17 : Grass Forage, Fodder & Hay Group (26) |
|
|
|
|
|
Clover, forage (7) |
|
|
Cowpea, forage (5) |
|
|
Soybean, forage (17) |
|
|
Trefoil, forage (3) |
|
|
Clover, hay (7) |
|
|
Cowpea, hay (6) |
|
|
Lespedeza, hay (1) |
|
|
Peanut, hay (19) |
|
|
Soybean, hay (17) |
|
|
Trefoil, hay (3) |
|
|
Vetch, hay (2) |
|
|
|
|
|
Alfalfa (21) |
|
|
|
|
|
Clover, forage (7) |
|
|
Trefoil, forage (3) |
|
|
Clover, hay (7) |
|
|
Lespedeza, hay (1) |
|
|
Trefoil, hay (3) |
|
|
Vetch, hay (2) |
|
|
|
|
|
|
|
|
Sunflower, seed (16) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
|
|
|
malathion [CHEBI:6651] (1) |
|
|
malathion [CHEBI:6651] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:6651] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
6651 |
ChEBI InChI Value: |
InChI=1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(18,13-3)14-4/h8H,5-7H2,1-4H3 |
ChEBI InChIKey Value: |
JXSJBGJIGXNWCI-UHFFFAOYSA-N |
ChEBI Compound Name: |
malathion |
ChEBI SMILES Value: |
CCOC(=O)CC(SP(=S)(OC)OC)C(=O)OCC |
ChEBI Substance ID: |
11533337 |
ChEBI URL: |
ChEBI:6651 |
ChemSpider ID: |
NS |
Ontomatica Chemical Accession Key (OnChAKey): |
JXSJBGJIGXNWCI_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
4004 |