more general categories |
information about this item |
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
02. Food Pesticide Chemicals with Regulated Residues on Food Commodities |
|
|
|
|
|
Banana (25) |
|
|
Peanut (30) |
|
|
Pineapple (16) |
|
|
|
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 01 Subgroup 1C : Tuberous & corm vegetables subgroup (16) |
|
|
|
|
|
Garlic, bulb (3) |
|
|
|
|
|
|
|
|
Onion, bulb (12) |
|
|
Garlic, bulb (3) |
|
|
Onion, bulb (12) |
|
|
|
|
|
|
|
|
Celery (10) |
|
|
Celery (10) |
|
|
|
|
|
Tomato (20) |
|
|
Eggplant (8) |
|
|
Tomato (20) |
|
|
|
|
|
|
|
|
Tomato (20) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
Eggplant (8) |
|
|
|
|
|
|
|
|
Watermelon (3) |
|
|
|
|
|
Cucumber (12) |
|
|
Pumpkin (8) |
|
|
Squash, winter (7) |
|
|
Cultivars, Varieties, and/or Hybrids of Crop Group 10 : Citrus Fruit Group (22) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
Apple (37) |
|
|
Pear (21) |
|
|
Apple (37) |
|
|
Pear (21) |
|
|
|
|
|
|
|
|
Peanut, hay (19) |
|
|
|
|
|
|
|
|
Pepper, black (3) |
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
oxamyl [CHEBI:38539] (1) |
|
|
05. Industrial Uses |
|
|
|
05. Industrial Uses |
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
oxamyl [CHEBI:38539] (1) |
|
|
08. Chemical Category |
|
|
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
oxamyl [CHEBI:38539] (1) |
|
|
ChEBI Compound Accession Identifier: |
[CHEBI:38539] |
ChEBI Compound Description: |
null |
ChEBI Compound Identification Number: |
38539 |
ChEBI InChI Value: |
InChI=1S/C7H13N3O3S/c1-8-7(12)13-9-5(14-4)6(11)10(2)3/h1-4H3,(H,8,12) |
ChEBI InChIKey Value: |
KZAUOCCYDRDERY-UHFFFAOYSA-N |
ChEBI Compound Name: |
oxamyl |
ChEBI SMILES Value: |
CNC(=O)ON=C(SC)C(=O)N(C)C |
ChEBI Substance ID: |
24775769 |
ChEBI URL: |
ChEBI:38539 |
ChemSpider ID: |
29356 |
Ontomatica Chemical Accession Key (OnChAKey): |
KZAUOCCYDRDERY_UHFFFAOYSA_N_000_000000 |
PubChem Compound ID: |
31657 |