more general categories |
information about this item |
|
01. Food Nutrient & Dietary Chemicals |
 |
 |
|
01. Food Nutrient & Dietary Chemicals |
|
|
|
|
|
phytic acid [ChEBI:17401] (1) |
|
|
phytic acid [ChEBI:17401] (1) |
|
 |
03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
 |
05. Industrial Uses |
 |
 |
|
05. Industrial Uses |
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
 |
08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
 |
09. Chemical Capabilities |
 |
 |
|
09. Chemical Capabilities |
|
|
|
|
|
|
|
|
myo-inositol hexakisphosphate [CHEBI:17401] (1) |
|
 |
ChEBI Compound Accession Identifier: |
[CHEBI:17401] |
ChEBI Compound Description: |
A myo-inositol hexakisphosphate in which each hydroxy group of myo-inositol is monophosphorylated. |
ChEBI Compound Identification Number: |
17401 |
ChEBI InChI Value: |
InChI=1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1-,2-,3-,4+,5-,6- |
ChEBI InChIKey Value: |
IMQLKJBTEOYOSI-GPIVLXJGSA-N |
ChEBI Compound Name: |
myo-inositol hexakisphosphate |
ChEBI SMILES Value: |
OP(O)(=O)O[C@@H]1[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
ChEBI Substance ID: |
8144153 |
ChEBI URL: |
ChEBI:17401 |
ChemSpider ID: |
16735966 |
Ontomatica Chemical Accession Key (OnChAKey): |
IMQLKJBTEOYOSI_GPIVLXJGSA_N_000_000000 |
PubChem Compound ID: |
890 |