Item 20 of 29 (back to results) previous next neoglucobrassicin An indolyl carbohydrate that is glucobrassicin methoxy substituted at position 1 of the indole moiety.

Current search: 01. Food Nutrient & Dietary Chemicals:  organosulfur compound [CHEBI:33261] > S-glycosyl compound [CHEBI:35275] × Select any link to see items in a related category. more general categories    information about this item 01. Food Nutrient & Dietary Chemicals  01. Food Nutrient & Dietary Chemicals   organosulfur compound [CHEBI:33261] (36)   S-glycosyl compound [CHEBI:35275] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1) 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   neoglucobrassicin [CHEBI:27506] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  sulfur molecular entity [CHEBI:26835] (1541)   organosulfur compound [CHEBI:33261] (1005)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   hydroxylamine O-sulfonate [CHEBI:38035] (29)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organochalcogen compound [CHEBI:36962] (11874)   organosulfur compound [CHEBI:33261] (1005)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  organooxygen compound [CHEBI:36963] (11352)   glycosyl compound [CHEBI:63161] (1006)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  carbohydrate derivative [CHEBI:63299] (2582)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  thiosugar [CHEBI:73754] (38)   S-glycosyl compound [CHEBI:35275] (37)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   indolyl carbohydrate [CHEBI:24821] (14)   neoglucobrassicin [CHEBI:27506] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   oxoacid derivative [CHEBI:33241] (3254)   sulfur oxoacid derivative [CHEBI:33424] (628)   sulfonic acid derivative [CHEBI:33552] (393)   hydroxylamine O-sulfonate [CHEBI:38035] (29)   glycosinolate [CHEBI:24401] (29)   glucosinolate [CHEBI:24279] (29)   indolylmethylglucosinolate [CHEBI:24796] (5)   neoglucobrassicin [CHEBI:27506] (1) ChEBI Compound Accession Identifier:   [CHEBI:27506] ChEBI Compound Description:   An indolyl carbohydrate that is glucobrassicin methoxy substituted at position 1 of the indole moiety. ChEBI Compound Identification Number:   27506 ChEBI InChI Value:   InChI=1S/C17H22N2O10S2/c1-27-19-7-9(10-4-2-3-5-11(10)19)6-13(18-29-31(24,25)26)30-17-16(23)15(22)14(21)12(8-20)28-17/h2-5,7,12,14-17,20-23H,6,8H2,1H3,(H,24,25,26)/t12-,14-,15+,16-,17+/m1/s1 ChEBI InChIKey Value:   PKKMITFKYRCCOL-CMZRPVNOSA-N ChEBI Compound Name:   neoglucobrassicin ChEBI SMILES Value:   COn1cc(CC(S[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)=NOS(O)(=O)=O)c2ccccc12 ChEBI Substance ID:   14717688 ChEBI URL:   ChEBI:27506 ChemSpider ID:   7850861 Ontomatica Chemical Accession Key (OnChAKey):   PKKMITFKYRCCOL_CMZRPVNOSA_N_000_000000 PubChem Compound ID:   9576416